EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9642 - N-tosyl-L-phenylalanyl chloromethyl ketone
| Formula | C17H18ClNO3S |
| Net Charge | 0 |
| Average Mass | 351.855 |
| Monoisotopic Mass | 351.06959 |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C17H18ClNO3S/c1-13-7-9-15(10-8-13)23(21,22)19-16(17(20)12-18)11-14-5-3-2-4-6-14/h2-10,16,19H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | MQUQNUAYKLCRME-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Roles: | serine proteinase inhibitor An exogenous or endogenous compound which inhibits serine endopeptidases. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-tosyl-L-phenylalanyl chloromethyl ketone (CHEBI:9642) has part L-phenylalanyl group (CHEBI:32496) |
| N-tosyl-L-phenylalanyl chloromethyl ketone (CHEBI:9642) has role alkylating agent (CHEBI:22333) |
| N-tosyl-L-phenylalanyl chloromethyl ketone (CHEBI:9642) has role serine proteinase inhibitor (CHEBI:48353) |
| N-tosyl-L-phenylalanyl chloromethyl ketone (CHEBI:9642) is a sulfonamide (CHEBI:35358) |
| N-tosyl-L-phenylalanyl chloromethyl ketone (CHEBI:9642) is a α-chloroketone (CHEBI:51841) |
| IUPAC Name |
|---|
| N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
| Synonyms | Source |
|---|---|
| Tos-Phe-CH2Cl | KEGG COMPOUND |
| TPCK | KEGG COMPOUND |
| N-Tosyl-L-phenylalanyl chloromethyl ketone | KEGG COMPOUND |
| Tosylphenylalanyl chloromethyl ketone | ChemIDplus |
| L-1-Tosylamido-2-phenylethyl chloromethyl ketone | ChemIDplus |
| N-Tosyl-L-phenylalanine chloromethyl ketone | ChemIDplus |