EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N4O3S |
| Net Charge | 0 |
| Average Mass | 348.428 |
| Monoisotopic Mass | 348.12561 |
| SMILES | Cc1cccc(Nc2ccncc2S(=O)(=O)NC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-11(2)18-16(21)20-24(22,23)15-10-17-8-7-14(15)19-13-6-4-5-12(3)9-13/h4-11H,1-3H3,(H,17,19)(H2,18,20,21) |
| InChIKey | NGBFQHCMQULJNZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. loop diuretic A diuretic that acts on the ascending loop of Henle in the kidney. hypoglycemic agent A drug which lowers the blood glucose level. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torasemide (CHEBI:9637) has functional parent 4-aminopyridine (CHEBI:34385) |
| torasemide (CHEBI:9637) has role antihypertensive agent (CHEBI:35674) |
| torasemide (CHEBI:9637) has role cardiovascular drug (CHEBI:35554) |
| torasemide (CHEBI:9637) has role hypoglycemic agent (CHEBI:35526) |
| torasemide (CHEBI:9637) has role loop diuretic (CHEBI:77608) |
| torasemide (CHEBI:9637) is a N-sulfonylurea (CHEBI:76983) |
| torasemide (CHEBI:9637) is a aminopyridine (CHEBI:38207) |
| torasemide (CHEBI:9637) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| 4'-hydroxy torasemide (CHEBI:155915) has functional parent torasemide (CHEBI:9637) |
| hydroxy torasemide (CHEBI:155897) has functional parent torasemide (CHEBI:9637) |
| torasemide carboxylic acid (CHEBI:155916) has functional parent torasemide (CHEBI:9637) |
| IUPAC Name |
|---|
| 4-(3-methylanilino)-N-(propan-2-ylcarbamoyl)pyridine-3-sulfonamide |
| INNs | Source |
|---|---|
| torasemida | WHO MedNet |
| torasemide | WHO MedNet |
| torasémide | WHO MedNet |
| torasemidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-isopropyl-3-((4-m-toluidino-3-pyridyl)sulfonyl)urea | ChemIDplus |
| AC 4464 | ChemIDplus |
| AC-4464 | DrugBank |
| AC4464 | ChemIDplus |
| BM 02015 | ChemIDplus |
| BM-02.015 | DrugBank |
| Brand Names | Source |
|---|---|
| Demadex | KEGG DRUG |
| Isemid | ChEMBL |
| Luprac | KEGG DRUG |
| Soaanz | ChEMBL |
| Torem | ChEBI |
| Torem 10 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2708 | DrugCentral |
| D00382 | KEGG DRUG |
| DB00214 | DrugBank |
| HMDB0014359 | HMDB |
| LSM-2662 | LINCS |
| Torasemide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:498515 | Reaxys |
| CAS:56211-40-6 | KEGG DRUG |
| CAS:56211-40-6 | ChemIDplus |
| Citations |
|---|