EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9622 - tolterodine
| Formula | C22H31NO |
| Net Charge | 0 |
| Average Mass | 325.496 |
| Monoisotopic Mass | 325.24056 |
| SMILES | Cc1ccc(O)c([C@H](CCN(C(C)C)C(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1 |
| InChIKey | OOGJQPCLVADCPB-HXUWFJFHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolterodine (CHEBI:9622) has functional parent p-cresol (CHEBI:17847) |
| tolterodine (CHEBI:9622) has role antispasmodic drug (CHEBI:53784) |
| tolterodine (CHEBI:9622) has role muscarinic antagonist (CHEBI:48876) |
| tolterodine (CHEBI:9622) has role muscle relaxant (CHEBI:51371) |
| tolterodine (CHEBI:9622) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| tolterodine tartrate (CHEBI:32245) has part tolterodine (CHEBI:9622) |
| IUPAC Name |
|---|
| 2-[(1R)-3-(diisopropylamino)-1-phenylpropyl]-4-methylphenol |
| INNs | Source |
|---|---|
| tolterodine | WHO MedNet |
| tolterodinum | WHO MedNet |
| toltérodine | WHO MedNet |
| tolterodina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tolterodine | KEGG COMPOUND |
| (+)-(R)-2-(alpha-(2-(Diisopropylamino)ethyl)benzyl)-p-cresol | ChemIDplus |
| (+)-Tolterodine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8070733 | Beilstein |
| CAS:124937-51-5 | ChemIDplus |