EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | COc1cc2oc3c(OC)c(OC)c(O)cc3c2cc1O |
| InChI | InChI=1S/C15H14O6/c1-18-12-6-11-7(4-9(12)16)8-5-10(17)14(19-2)15(20-3)13(8)21-11/h4-6,16-17H,1-3H3 |
| InChIKey | BUJOWQKLLDUNTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,8-dihydroxy-3,4,7-trimethoxydibenzofuran (CHEBI:961) has parent hydride dibenzofuran (CHEBI:28145) |
| 2,8-dihydroxy-3,4,7-trimethoxydibenzofuran (CHEBI:961) has role plant metabolite (CHEBI:76924) |
| 2,8-dihydroxy-3,4,7-trimethoxydibenzofuran (CHEBI:961) is a aromatic ether (CHEBI:35618) |
| 2,8-dihydroxy-3,4,7-trimethoxydibenzofuran (CHEBI:961) is a dibenzofurans (CHEBI:38922) |
| 2,8-dihydroxy-3,4,7-trimethoxydibenzofuran (CHEBI:961) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3,4,7-trimethoxydibenzo[b,d]furan-2,8-diol |
| Synonym | Source |
|---|---|
| 2,8-Dihydroxy-3,4,7-trimethoxydibenzofuran | KEGG COMPOUND |