EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9587 - ticarcillin
| Formula | C15H16N2O6S2 |
| Net Charge | 0 |
| Average Mass | 384.435 |
| Monoisotopic Mass | 384.04498 |
| SMILES | [H][C@](C(=O)O)(C(=O)N[C@@H]1C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@]12[H])c1ccsc1 |
| InChI | InChI=1S/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7-,8-,9+,12-/m1/s1 |
| InChIKey | OHKOGUYZJXTSFX-KZFFXBSXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ticarcillin (CHEBI:9587) has role antibacterial drug (CHEBI:36047) |
| ticarcillin (CHEBI:9587) is a penicillin (CHEBI:17334) |
| ticarcillin (CHEBI:9587) is a penicillin allergen (CHEBI:88187) |
| ticarcillin (CHEBI:9587) is conjugate acid of ticarcillin(2−) (CHEBI:51811) |
| Incoming Relation(s) |
| ticarcillin(2−) (CHEBI:51811) is conjugate base of ticarcillin (CHEBI:9587) |
| IUPAC Name |
|---|
| 6β-{[(2R)-2-carboxy-2-thiophen-3-ylacetyl]amino}-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| ticarcilina | ChemIDplus |
| ticarcillin | ChemIDplus |
| ticarcilline | ChemIDplus |
| ticarcillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-{[(2R)-2-carboxy-2-thiophen-3-ylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| α-carboxy-3-thienylmethylpenicillin | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6009447 | Reaxys |
| CAS:34787-01-4 | KEGG COMPOUND |
| CAS:34787-01-4 | ChemIDplus |
| Citations |
|---|