EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O6S2 |
| Net Charge | -2 |
| Average Mass | 382.419 |
| Monoisotopic Mass | 382.03043 |
| SMILES | [H][C@](C(=O)[O-])(C(=O)N[C@@H]1C(=O)N2[C@@H](C(=O)[O-])C(C)(C)S[C@]12[H])c1ccsc1 |
| InChI | InChI=1S/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/p-2/t7-,8-,9+,12-/m1/s1 |
| InChIKey | OHKOGUYZJXTSFX-KZFFXBSXSA-L |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ticarcillin(2−) (CHEBI:51811) is a penicillinate anion (CHEBI:51356) |
| ticarcillin(2−) (CHEBI:51811) is conjugate base of ticarcillin (CHEBI:9587) |
| Incoming Relation(s) |
| ticarcillin disodium (CHEBI:35017) has part ticarcillin(2−) (CHEBI:51811) |
| ticarcillin (CHEBI:9587) is conjugate acid of ticarcillin(2−) (CHEBI:51811) |
| IUPAC Name |
|---|
| 6β-{[(2R)-2-carboxylato-2-thiophen-3-ylacetyl]amino}-2,2-dimethylpenam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-6-{[(2R)-2-carboxylato-2-thiophen-3-ylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5780670 | Beilstein |