EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=CC[C@]2(C)CCCC(C)(C)[C@@]23C[C@@H]13 |
| InChI | InChI=1S/C15H24/c1-11-6-9-14(4)8-5-7-13(2,3)15(14)10-12(11)15/h6,12H,5,7-10H2,1-4H3/t12-,14-,15-/m0/s1 |
| InChIKey | WXQGPFZDVCRBME-QEJZJMRPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum habrochaites (ncbitaxon:62890) | - | PubMed (21818683) | |
| Vitis vinifera (ncbitaxon:29760) | - | DOI (10.1016/j.chroma.2012.01.002) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-thujopsene (CHEBI:9578) has role plant metabolite (CHEBI:76924) |
| (−)-thujopsene (CHEBI:9578) is a thujopsene (CHEBI:61736) |
| (−)-thujopsene (CHEBI:9578) is enantiomer of (+)-thujopsene (CHEBI:61737) |
| Incoming Relation(s) |
| (+)-thujopsene (CHEBI:61737) is enantiomer of (−)-thujopsene (CHEBI:9578) |
| IUPAC Name |
|---|
| (1aS,4aS,8aS)-2,4a,8,8-tetramethyl-1,1a,4,4a,5,6,7,8-octahydrocyclopropa[d]naphthalene |
| Synonyms | Source |
|---|---|
| (1aS,4aS,8aS)-2,4a,8,8-tetramethyl-1H,1aH,4H,4aH,5H,6H,7H,8H-cyclopropa[e]naphthalene | IUPAC |
| (1S,6S,10S)-2,2,6,9-Tetramethyltricyclo[8.1.0.01.6]undec-8-ene | ChEBI |
| (Z)-thujopsene | SUBMITTER |
| sesquichamene | ChemIDplus |
| Thujopsene | KEGG COMPOUND |
| (−)-widdrene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-thujopsene | UniProt |