EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=CC[C@@]2(C)CCCC(C)(C)[C@]23C[C@H]13 |
| InChI | InChI=1S/C15H24/c1-11-6-9-14(4)8-5-7-13(2,3)15(14)10-12(11)15/h6,12H,5,7-10H2,1-4H3/t12-,14-,15-/m1/s1 |
| InChIKey | WXQGPFZDVCRBME-BPLDGKMQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-thujopsene (CHEBI:61737) is a thujopsene (CHEBI:61736) |
| (+)-thujopsene (CHEBI:61737) is enantiomer of (−)-thujopsene (CHEBI:9578) |
| Incoming Relation(s) |
| (−)-thujopsene (CHEBI:9578) is enantiomer of (+)-thujopsene (CHEBI:61737) |
| IUPAC Name |
|---|
| (1aR,4aR,8aR)-2,4a,8,8-tetramethyl-1,1a,4,4a,5,6,7,8-octahydrocyclopropa[d]naphthalene |
| UniProt Name | Source |
|---|---|
| (+)-thujopsene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8236 | MetaCyc |
| Citations |
|---|