EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1O[C@H]2C[C@H](O2)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18-14-20(24-17)25-18)10-7-4-5-8-11-19(22)23/h4,7,12-13,15-18,20-21H,2-3,5-6,8-11,14H2,1H3,(H,22,23)/b7-4-,13-12+/t15-,16+,17+,18-,20+/m0/s1 |
| InChIKey | DSNBHJFQCNUKMA-SCKDECHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thromboxane A2 (CHEBI:15627) has role mouse metabolite (CHEBI:75771) |
| thromboxane A2 (CHEBI:15627) is a epoxy monocarboxylic acid (CHEBI:23931) |
| thromboxane A2 (CHEBI:15627) is a thromboxanes A (CHEBI:36088) |
| thromboxane A2 (CHEBI:15627) is conjugate acid of thromboxane A2(1−) (CHEBI:57445) |
| Incoming Relation(s) |
| 18-hydroxythromboxane A2 (CHEBI:138584) has functional parent thromboxane A2 (CHEBI:15627) |
| 19-hydroxythromboxane A2 (CHEBI:138583) has functional parent thromboxane A2 (CHEBI:15627) |
| carbocyclic thromboxane A2 (CHEBI:139043) has functional parent thromboxane A2 (CHEBI:15627) |
| thromboxane A2(1−) (CHEBI:57445) is conjugate base of thromboxane A2 (CHEBI:15627) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α-epoxy-15-hydroxythromboxa-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| Thromboxane A2 | KEGG COMPOUND |
| (5Z,13E)-(15S)-9alpha,11alpha-Epoxy-15-hydroxythromboxa-5,13-dienoate | KEGG COMPOUND |
| (5Z,9alpha,11alpha,13E,15S)-9,11-Epoxy-15-hydroxythromboxa-5,13-dien-1-oic acid | KEGG COMPOUND |
| 9S,11S-epoxy,15S-hydroxy-thromboxa-5Z,13E-dien-1-oic acid | LIPID MAPS |
| TXA-2 | ChemIDplus |
| TXA2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02198 | KEGG COMPOUND |
| LMFA03030001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:57576-52-0 | KEGG COMPOUND |