EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | CC(O)CCC[C@H](O)/C=C/[C@H]1O[C@H]2C[C@H](O2)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O6/c1-14(21)7-6-8-15(22)11-12-17-16(18-13-20(25-17)26-18)9-4-2-3-5-10-19(23)24/h2,4,11-12,14-18,20-22H,3,5-10,13H2,1H3,(H,23,24)/b4-2-,12-11+/t14?,15-,16+,17+,18-,20+/m0/s1 |
| InChIKey | WOQBOHYWWJRXPR-SVALGRSTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15789615) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-hydroxythromboxane A2 (CHEBI:138583) has functional parent thromboxane A2 (CHEBI:15627) |
| 19-hydroxythromboxane A2 (CHEBI:138583) has role human xenobiotic metabolite (CHEBI:76967) |
| 19-hydroxythromboxane A2 (CHEBI:138583) is a diol (CHEBI:23824) |
| 19-hydroxythromboxane A2 (CHEBI:138583) is a epoxy monocarboxylic acid (CHEBI:23931) |
| 19-hydroxythromboxane A2 (CHEBI:138583) is a secondary allylic alcohol (CHEBI:134396) |
| 19-hydroxythromboxane A2 (CHEBI:138583) is a thromboxanes A (CHEBI:36088) |
| 19-hydroxythromboxane A2 (CHEBI:138583) is conjugate acid of 19-hydroxythromboxane A2(1−) (CHEBI:137988) |
| Incoming Relation(s) |
| 19-hydroxythromboxane A2(1−) (CHEBI:137988) is conjugate base of 19-hydroxythromboxane A2 (CHEBI:138583) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α-epoxy-15,19-dihydroxythromboxa-5,13-dien-1-oic acid |
| Synonym | Source |
|---|---|
| 19-hydroxy-TXA2 | ChEBI |
| Citations |
|---|