EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | CCC(O)CC[C@H](O)/C=C/[C@H]1O[C@H]2C[C@H](O2)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O6/c1-2-14(21)9-10-15(22)11-12-17-16(18-13-20(25-17)26-18)7-5-3-4-6-8-19(23)24/h3,5,11-12,14-18,20-22H,2,4,6-10,13H2,1H3,(H,23,24)/b5-3-,12-11+/t14?,15-,16+,17+,18-,20+/m0/s1 |
| InChIKey | BFIKSPBWSHKXFY-XLQYSURASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxythromboxane A2 (CHEBI:138584) has functional parent thromboxane A2 (CHEBI:15627) |
| 18-hydroxythromboxane A2 (CHEBI:138584) has role human xenobiotic metabolite (CHEBI:76967) |
| 18-hydroxythromboxane A2 (CHEBI:138584) is a diol (CHEBI:23824) |
| 18-hydroxythromboxane A2 (CHEBI:138584) is a epoxy monocarboxylic acid (CHEBI:23931) |
| 18-hydroxythromboxane A2 (CHEBI:138584) is a secondary allylic alcohol (CHEBI:134396) |
| 18-hydroxythromboxane A2 (CHEBI:138584) is a thromboxanes A (CHEBI:36088) |
| 18-hydroxythromboxane A2 (CHEBI:138584) is conjugate acid of 18-hydroxythromboxane A2(1−) (CHEBI:137989) |
| Incoming Relation(s) |
| 18-hydroxythromboxane A2(1−) (CHEBI:137989) is conjugate base of 18-hydroxythromboxane A2 (CHEBI:138584) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α-epoxy-15,18-dihydroxythromboxa-5,13-dien-1-oic acid |
| Synonym | Source |
|---|---|
| 18-hydroxy-TXA2 | ChEBI |