EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O5 |
| Net Charge | 0 |
| Average Mass | 136.103 |
| Monoisotopic Mass | 136.03717 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/m0/s1 |
| InChIKey | JPIJQSOTBSSVTP-STHAYSLISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Pycnandra acuminata (ncbitaxon:280718) | - | DOI (10.1016/j.phytochem.2007.07.001) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-threonic acid (CHEBI:15908) has role Daphnia magna metabolite (CHEBI:83056) |
| L-threonic acid (CHEBI:15908) has role algal metabolite (CHEBI:84735) |
| L-threonic acid (CHEBI:15908) has role plant metabolite (CHEBI:76924) |
| L-threonic acid (CHEBI:15908) is a threonic acid (CHEBI:26984) |
| L-threonic acid (CHEBI:15908) is conjugate acid of L-threonate (CHEBI:57561) |
| L-threonic acid (CHEBI:15908) is enantiomer of D-threonic acid (CHEBI:49059) |
| Incoming Relation(s) |
| (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) has functional parent L-threonic acid (CHEBI:15908) |
| 4-phospho-L-threonic acid (CHEBI:41917) has functional parent L-threonic acid (CHEBI:15908) |
| L-threonate (CHEBI:57561) is conjugate base of L-threonic acid (CHEBI:15908) |
| D-threonic acid (CHEBI:49059) is enantiomer of L-threonic acid (CHEBI:15908) |
| IUPAC Names |
|---|
| (2R,3S)-2,3,4-trihydroxybutanoic acid |
| L-threonic acid |
| Manual Xrefs | Databases |
|---|---|
| C00034314 | KNApSAcK |
| C01620 | KEGG COMPOUND |
| Threonic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722841 | Reaxys |
| CAS:7306-96-9 | ChemIDplus |
| CAS:7306-96-9 | KEGG COMPOUND |
| Citations |
|---|