EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:49059 - D-threonic acid
| Formula | C4H8O5 |
| Net Charge | 0 |
| Average Mass | 136.103 |
| Monoisotopic Mass | 136.03717 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/m1/s1 |
| InChIKey | JPIJQSOTBSSVTP-GBXIJSLDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-threonic acid (CHEBI:49059) is a threonic acid (CHEBI:26984) |
| D-threonic acid (CHEBI:49059) is conjugate acid of D-threonate (CHEBI:45912) |
| D-threonic acid (CHEBI:49059) is enantiomer of L-threonic acid (CHEBI:15908) |
| Incoming Relation(s) |
| 4-phospho-D-threonic acid (CHEBI:49069) has functional parent D-threonic acid (CHEBI:49059) |
| D-threonate (CHEBI:45912) is conjugate base of D-threonic acid (CHEBI:49059) |
| L-threonic acid (CHEBI:15908) is enantiomer of D-threonic acid (CHEBI:49059) |
| IUPAC Names |
|---|
| D-threonic acid |
| (2S,3R)-2,3,4-trihydroxybutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1722838 | Beilstein |