EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O5 |
| Net Charge | -1 |
| Average Mass | 135.095 |
| Monoisotopic Mass | 135.02990 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/p-1/t2-,3+/m0/s1 |
| InChIKey | JPIJQSOTBSSVTP-STHAYSLISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-threonate (CHEBI:57561) has role human metabolite (CHEBI:77746) |
| L-threonate (CHEBI:57561) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| L-threonate (CHEBI:57561) is a threonate (CHEBI:15243) |
| L-threonate (CHEBI:57561) is conjugate base of L-threonic acid (CHEBI:15908) |
| Incoming Relation(s) |
| L-threonic acid (CHEBI:15908) is conjugate acid of L-threonate (CHEBI:57561) |
| IUPAC Name |
|---|
| (2R,3S)-2,3,4-trihydroxybutanoate |
| UniProt Name | Source |
|---|---|
| L-threonate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2406678 | Gmelin |
| Beilstein:4973909 | Beilstein |