EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O10 |
| Net Charge | 0 |
| Average Mass | 344.272 |
| Monoisotopic Mass | 344.07435 |
| SMILES | O=C(O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C14H16O10/c15-6-1-5(2-7(16)10(6)18)12(20)24-9-4-14(23,13(21)22)3-8(17)11(9)19/h1-2,8-9,11,15-19,23H,3-4H2,(H,21,22)/t8-,9-,11-,14+/m1/s1 |
| InChIKey | LDPLFHGGZNSKDS-FTBFGRRBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theogallin (CHEBI:9522) has functional parent (−)-quinic acid (CHEBI:17521) |
| theogallin (CHEBI:9522) has functional parent gallic acid (CHEBI:30778) |
| theogallin (CHEBI:9522) is a gallate ester (CHEBI:37576) |
| theogallin (CHEBI:9522) is a monocarboxylic acid (CHEBI:25384) |
| theogallin (CHEBI:9522) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,3R,4R,5R)-1,3,4-trihydroxy-5-(3,4,5-trihydroxybenzoyloxy)cyclohexanecarboxylic acid |
| Synonym | Source |
|---|---|
| Theogallin | KEGG COMPOUND |
| Citations |
|---|