EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H35NO6S |
| Net Charge | 0 |
| Average Mass | 573.711 |
| Monoisotopic Mass | 573.21851 |
| SMILES | CC(C)c1ccccc1Cc1cc(C(=O)Nc2ccc(S(=O)(=O)c3ccccc3C(C)(C)C)cc2)c(O)c(O)c1O |
| InChI | InChI=1S/C33H35NO6S/c1-20(2)25-11-7-6-10-21(25)18-22-19-26(30(36)31(37)29(22)35)32(38)34-23-14-16-24(17-15-23)41(39,40)28-13-9-8-12-27(28)33(3,4)5/h6-17,19-20,35-37H,18H2,1-5H3,(H,34,38) |
| InChIKey | PQAPVTKIEGUPRN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | B-cell lymphoma 2 inhibitor Any inhibitor of B-cell lymphoma 2 protein. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TW-37 (CHEBI:95008) has role angiogenesis inhibitor (CHEBI:48422) |
| TW-37 (CHEBI:95008) has role antineoplastic agent (CHEBI:35610) |
| TW-37 (CHEBI:95008) has role apoptosis inducer (CHEBI:68495) |
| TW-37 (CHEBI:95008) has role B-cell lymphoma 2 inhibitor (CHEBI:133022) |
| TW-37 (CHEBI:95008) has role radiosensitizing agent (CHEBI:132992) |
| TW-37 (CHEBI:95008) is a benzamides (CHEBI:22702) |
| TW-37 (CHEBI:95008) is a benzenetriol (CHEBI:22707) |
| TW-37 (CHEBI:95008) is a secondary carboxamide (CHEBI:140325) |
| TW-37 (CHEBI:95008) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N-{4-[(2-tert-butylphenyl)sulfonyl]phenyl}-2,3,4-trihydroxy-5-[2-(propan-2-yl)benzyl]benzamide |
| Synonyms | Source |
|---|---|
| N-[4-[[2-(1,1-dimethylethyl)phenyl]sulfonyl]phenyl]-2,3,4-trihydroxy-5-[[2-(1-methylethyl)phenyl]methyl]-benzamide | ChEBI |
| N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide | ChEBI |
| TW 37 | ChEBI |
| TW37 | ChEBI |
| Citations |
|---|