EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H35NO6S |
| Net Charge | 0 |
| Average Mass | 573.711 |
| Monoisotopic Mass | 573.21851 |
| SMILES | CC(C)c1ccccc1Cc1cc(C(=O)Nc2ccc(S(=O)(=O)c3ccccc3C(C)(C)C)cc2)c(O)c(O)c1O |
| InChI | InChI=1S/C33H35NO6S/c1-20(2)25-11-7-6-10-21(25)18-22-19-26(30(36)31(37)29(22)35)32(38)34-23-14-16-24(17-15-23)41(39,40)28-13-9-8-12-27(28)33(3,4)5/h6-17,19-20,35-37H,18H2,1-5H3,(H,34,38) |
| InChIKey | PQAPVTKIEGUPRN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. B-cell lymphoma 2 inhibitor Any inhibitor of B-cell lymphoma 2 protein. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TW-37 (CHEBI:95008) has role angiogenesis inhibitor (CHEBI:48422) |
| TW-37 (CHEBI:95008) has role antineoplastic agent (CHEBI:35610) |
| TW-37 (CHEBI:95008) has role apoptosis inducer (CHEBI:68495) |
| TW-37 (CHEBI:95008) has role B-cell lymphoma 2 inhibitor (CHEBI:133022) |
| TW-37 (CHEBI:95008) has role radiosensitizing agent (CHEBI:132992) |
| TW-37 (CHEBI:95008) is a benzamides (CHEBI:22702) |
| TW-37 (CHEBI:95008) is a benzenetriol (CHEBI:22707) |
| TW-37 (CHEBI:95008) is a secondary carboxamide (CHEBI:140325) |
| TW-37 (CHEBI:95008) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N-{4-[(2-tert-butylphenyl)sulfonyl]phenyl}-2,3,4-trihydroxy-5-[2-(propan-2-yl)benzyl]benzamide |
| Synonyms | Source |
|---|---|
| N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide | ChEBI |
| TW 37 | ChEBI |
| TW37 | ChEBI |
| N-[4-[[2-(1,1-dimethylethyl)phenyl]sulfonyl]phenyl]-2,3,4-trihydroxy-5-[[2-(1-methylethyl)phenyl]methyl]-benzamide | ChEBI |
| Citations |
|---|