EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H37NO12 |
| Net Charge | 0 |
| Average Mass | 627.643 |
| Monoisotopic Mass | 627.23158 |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CO)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O[C@@H]2CCCCO2)[C@H](C)O1 |
| InChI | InChI=1S/C32H37NO12/c1-14-31(45-21-8-3-4-9-42-21)17(33)10-22(43-14)44-19-12-32(40,20(35)13-34)11-16-24(19)30(39)26-25(28(16)37)27(36)15-6-5-7-18(41-2)23(15)29(26)38/h5-7,14,17,19,21-22,31,34,37,39-40H,3-4,8-13,33H2,1-2H3/t14-,17-,19-,21+,22-,31+,32-/m0/s1 |
| InChIKey | KMSKQZKKOZQFFG-YXRRJAAWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirarubicin (CHEBI:94770) has functional parent doxorubicin (CHEBI:28748) |
| pirarubicin (CHEBI:94770) has role antineoplastic agent (CHEBI:35610) |
| pirarubicin (CHEBI:94770) has role cardiotoxic agent (CHEBI:50912) |
| pirarubicin (CHEBI:94770) is a p-quinones (CHEBI:25830) |
| pirarubicin (CHEBI:94770) is a aminoglycoside (CHEBI:47779) |
| pirarubicin (CHEBI:94770) is a anthracycline (CHEBI:48120) |
| pirarubicin (CHEBI:94770) is a deoxy hexoside (CHEBI:35315) |
| pirarubicin (CHEBI:94770) is a monosaccharide derivative (CHEBI:63367) |
| pirarubicin (CHEBI:94770) is a oxanes (CHEBI:46942) |
| pirarubicin (CHEBI:94770) is a primary α-hydroxy ketone (CHEBI:139590) |
| pirarubicin (CHEBI:94770) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| pirarubicin (CHEBI:94770) is a tetracenequinones (CHEBI:51286) |
| IUPAC Name |
|---|
| (1S,3S)-3,5,12-trihydroxy-3-(hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxy-4-O-[(2R)-tetrahydro-2H-pyran-2-yl]-α-L-lyxo-hexopyranoside |
| INNs | Source |
|---|---|
| pirarubicin | WHO MedNet |
| pirarubicina | WHO MedNet |
| pirarubicine | WHO MedNet |
| pirarubicinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2''R)-4'-O-tetrahydropyranyladriamycin | ChEBI |
| (2''R)-4'-O-tetrahydropyranyldoxorubicin | ChEBI |
| 4'-O-tetrahydropyranyladriamycin | ChEBI |
| (8S,10S)-10-[[3-Amino-2,3,6-trideoxy-4-O-[(2R)-tetrahydro-2H-pyran-2-yl]-α-L-lyxo-hexopyranosyl]oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(2-hydroxyacetyl)-1-methoxy-5,12-naphthacenedione | ChEBI |
| adriamycin, tetrahydropyranyl | DrugBank |
| theprubicin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2198 | DrugCentral |
| D01885 | KEGG DRUG |
| DB11616 | DrugBank |
| LSM-5899 | LINCS |
| Pirarubicin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:72496-41-4 | ChEBI |
| Citations |
|---|