EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO4 |
| Net Charge | 0 |
| Average Mass | 239.271 |
| Monoisotopic Mass | 239.11576 |
| SMILES | CCOC(=O)[C@@](C)(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H17NO4/c1-3-17-11(16)12(2,13)7-8-4-5-9(14)10(15)6-8/h4-6,14-15H,3,7,13H2,1-2H3/t12-/m0/s1 |
| InChIKey | SVEBYYWCXTVYCR-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-methyl-L-dopa ethyl ester (CHEBI:94761) has functional parent α-methyl-L-dopa (CHEBI:61058) |
| α-methyl-L-dopa ethyl ester (CHEBI:94761) has role antihypertensive agent (CHEBI:35674) |
| α-methyl-L-dopa ethyl ester (CHEBI:94761) has role α-adrenergic agonist (CHEBI:35569) |
| α-methyl-L-dopa ethyl ester (CHEBI:94761) is a amphetamines (CHEBI:35338) |
| α-methyl-L-dopa ethyl ester (CHEBI:94761) is a ethyl ester (CHEBI:23990) |
| IUPAC Name |
|---|
| ethyl 3-hydroxy-α-methyl-L-tyrosinate |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid ethyl ester | ChEBI |
| alpha-Methyldopa ethyl ester | DrugCentral |
| ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate | IUPAC |
| methyldopate | ChEMBL |
| Methyl-L-dopa ethyl ester | DrugCentral |
| Citations |
|---|