EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61058 - α-methyl-L-dopa
| Formula | C10H13NO4 |
| Net Charge | 0 |
| Average Mass | 211.217 |
| Monoisotopic Mass | 211.08446 |
| SMILES | C[C@](N)(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H13NO4/c1-10(11,9(14)15)5-6-2-3-7(12)8(13)4-6/h2-4,12-13H,5,11H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | CJCSPKMFHVPWAR-JTQLQIEISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-methyl-L-dopa (CHEBI:61058) has role antihypertensive agent (CHEBI:35674) |
| α-methyl-L-dopa (CHEBI:61058) has role hapten (CHEBI:59174) |
| α-methyl-L-dopa (CHEBI:61058) has role peripheral nervous system drug (CHEBI:49110) |
| α-methyl-L-dopa (CHEBI:61058) has role sympatholytic agent (CHEBI:66991) |
| α-methyl-L-dopa (CHEBI:61058) has role α-adrenergic agonist (CHEBI:35569) |
| α-methyl-L-dopa (CHEBI:61058) is a L-tyrosine derivative (CHEBI:27177) |
| α-methyl-L-dopa (CHEBI:61058) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| 3-methoxy-α-methyl-L-tyrosine (CHEBI:141143) has functional parent α-methyl-L-dopa (CHEBI:61058) |
| α-methyl-L-dopa ethyl ester (CHEBI:94761) has functional parent α-methyl-L-dopa (CHEBI:61058) |
| IUPAC Name |
|---|
| 3-hydroxy-α-methyl-L-tyrosine |
| INNs | Source |
|---|---|
| methyldopa | KEGG DRUG |
| methyldopum | ChemIDplus |
| metildopa | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid | IUPAC |
| 3-Hydroxy-alpha-methyl-L-tyrosine | ChemIDplus |
| Alpha medopa | DrugBank |
| alpha-Methyl-beta-(3,4-dihydroxyphenyl)-L-alanine | ChemIDplus |
| alpha-Methyldihydroxyphenylalanine | ChemIDplus |
| alpha-Methyl dopa | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1762 | DrugCentral |
| C07194 | KEGG COMPOUND |
| D08205 | KEGG DRUG |
| DB00968 | DrugBank |
| HMDB0011754 | HMDB |
| LSM-5596 | LINCS |
| Methyldopa | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2807721 | Reaxys |
| CAS:555-30-6 | ChemIDplus |
| CAS:555-30-6 | KEGG COMPOUND |
| Citations |
|---|