EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO4 |
| Net Charge | 0 |
| Average Mass | 211.217 |
| Monoisotopic Mass | 211.08446 |
| SMILES | C[C@](N)(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H13NO4/c1-10(11,9(14)15)5-6-2-3-7(12)8(13)4-6/h2-4,12-13H,5,11H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | CJCSPKMFHVPWAR-JTQLQIEISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-methyl-L-dopa (CHEBI:61058) has role antihypertensive agent (CHEBI:35674) |
| α-methyl-L-dopa (CHEBI:61058) has role hapten (CHEBI:59174) |
| α-methyl-L-dopa (CHEBI:61058) has role peripheral nervous system drug (CHEBI:49110) |
| α-methyl-L-dopa (CHEBI:61058) has role sympatholytic agent (CHEBI:66991) |
| α-methyl-L-dopa (CHEBI:61058) has role α-adrenergic agonist (CHEBI:35569) |
| α-methyl-L-dopa (CHEBI:61058) is a L-tyrosine derivative (CHEBI:27177) |
| α-methyl-L-dopa (CHEBI:61058) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| 3-methoxy-α-methyl-L-tyrosine (CHEBI:141143) has functional parent α-methyl-L-dopa (CHEBI:61058) |
| α-methyl-L-dopa ethyl ester (CHEBI:94761) has functional parent α-methyl-L-dopa (CHEBI:61058) |
| IUPAC Name |
|---|
| 3-hydroxy-α-methyl-L-tyrosine |
| INNs | Source |
|---|---|
| methyldopa | KEGG DRUG |
| methyldopum | ChemIDplus |
| metildopa | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid | IUPAC |
| 3-Hydroxy-alpha-methyl-L-tyrosine | ChemIDplus |
| Alpha medopa | DrugBank |
| alpha-Methyl-beta-(3,4-dihydroxyphenyl)-L-alanine | ChemIDplus |
| alpha-Methyldihydroxyphenylalanine | ChemIDplus |
| alpha-Methyl dopa | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1762 | DrugCentral |
| C07194 | KEGG COMPOUND |
| D08205 | KEGG DRUG |
| DB00968 | DrugBank |
| HMDB0011754 | HMDB |
| LSM-5596 | LINCS |
| Methyldopa | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2807721 | Reaxys |
| CAS:555-30-6 | ChemIDplus |
| CAS:555-30-6 | KEGG COMPOUND |
| Citations |
|---|