EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O8 |
| Net Charge | 0 |
| Average Mass | 384.425 |
| Monoisotopic Mass | 384.17842 |
| SMILES | C[C@H]1[C@@H](OC(=O)CCC(=O)O)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C19H28O8/c1-10-4-5-13-11(2)16(23-15(22)7-6-14(20)21)24-17-19(13)12(10)8-9-18(3,25-17)26-27-19/h10-13,16-17H,4-9H2,1-3H3,(H,20,21)/t10-,11-,12+,13+,16+,17-,18-,19-/m1/s1 |
| InChIKey | FIHJKUPKCHIPAT-NKHDUEHSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-5859 (CHEBI:94751) is a artemisinin derivative (CHEBI:63920) |
| LSM-5859 (CHEBI:94751) is a hemisuccinate (CHEBI:138979) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5859 | LINCS |