EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O3 |
| Net Charge | 0 |
| Average Mass | 400.603 |
| Monoisotopic Mass | 400.29775 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](OC(=O)CCCCCC)CC[C@@]21[H] |
| InChI | InChI=1S/C26H40O3/c1-4-5-6-7-8-24(28)29-23-12-11-21-20-10-9-18-17-19(27)13-15-25(18,2)22(20)14-16-26(21,23)3/h17,20-23H,4-16H2,1-3H3/t20-,21-,22-,23-,25-,26-/m0/s1 |
| InChIKey | VOCBWIIFXDYGNZ-IXKNJLPQSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| testosterone enanthate (CHEBI:9464) has functional parent testosterone (CHEBI:17347) |
| testosterone enanthate (CHEBI:9464) has role androgen (CHEBI:50113) |
| testosterone enanthate (CHEBI:9464) is a heptanoate ester (CHEBI:50898) |
| testosterone enanthate (CHEBI:9464) is a sterol ester (CHEBI:35915) |
| IUPAC Name |
|---|
| 3-oxoandrost-4-en-17β-yl heptanoate |
| Synonyms | Source |
|---|---|
| 17-((1-Oxoheptyl)oxy)androst-4-en-3-one | ChemIDplus |
| 17-Hydroxyandrost-4-en-3-one, 17-heptanoate | ChemIDplus |
| 17β-hydroxyandrost-4-en-3-one heptanoate | NIST Chemistry WebBook |
| Testosterone 17-enanthate | ChemIDplus |
| Testosterone heptanoate | ChemIDplus |