EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O3 |
| Net Charge | 0 |
| Average Mass | 412.614 |
| Monoisotopic Mass | 412.29775 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](OC(=O)CCC3CCCC3)CC[C@@]21[H] |
| InChI | InChI=1S/C27H40O3/c1-26-15-13-20(28)17-19(26)8-9-21-22-10-11-24(27(22,2)16-14-23(21)26)30-25(29)12-7-18-5-3-4-6-18/h17-18,21-24H,3-16H2,1-2H3/t21-,22-,23-,24-,26-,27-/m0/s1 |
| InChIKey | HPFVBGJFAYZEBE-ZLQWOROUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| testosterone cypionate (CHEBI:9463) has functional parent 3-cyclopentylpropionic acid (CHEBI:50899) |
| testosterone cypionate (CHEBI:9463) has functional parent testosterone (CHEBI:17347) |
| testosterone cypionate (CHEBI:9463) has role antineoplastic agent (CHEBI:35610) |
| testosterone cypionate (CHEBI:9463) is a sterol ester (CHEBI:35915) |
| IUPAC Name |
|---|
| 3-oxoandrost-4-en-17β-yl 3-cyclopentylpropanoate |
| Synonyms | Source |
|---|---|
| NSC-9157 | ChEMBL |
| Testosterone 17.beta.-cyclopentanepropionate | ChEMBL |
| testosterone 17β-cyclopentanepropionate | NIST Chemistry WebBook |
| testosterone 17β-cyclopentylpropionate | NIST Chemistry WebBook |
| testosterone 17β-cypionate | NIST Chemistry WebBook |
| Testosterone cipionate | ChEMBL |
| Brand Names | Source |
|---|---|
| Andro-cyp | ChEMBL |
| Azmiro | ChEMBL |
| Depotest | ChEMBL |
| Depo-testosterone | ChEMBL |
| Testosterone cypionate component of depo-testadiol | ChEMBL |
| Citations |
|---|