EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C12H19NO3.H2O4S |
| Net Charge | 0 |
| Average Mass | 548.655 |
| Monoisotopic Mass | 548.24037 |
| SMILES | CC(C)(C)NCC(O)c1cc(O)cc(O)c1.CC(C)(C)NCC(O)c1cc(O)cc(O)c1.O=S(=O)(O)O |
| InChI | InChI=1S/2C12H19NO3.H2O4S/c2*1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8;1-5(2,3)4/h2*4-6,11,13-16H,7H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | KFVSLSTULZVNPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbutaline sulfate (CHEBI:9450) has functional parent terbutaline (CHEBI:9449) |
| terbutaline sulfate (CHEBI:9450) has role anti-asthmatic agent (CHEBI:65023) |
| terbutaline sulfate (CHEBI:9450) has role antispasmodic drug (CHEBI:53784) |
| terbutaline sulfate (CHEBI:9450) is a ethanolamine sulfate salt (CHEBI:38016) |
| Synonyms | Source |
|---|---|
| Brethine | KEGG COMPOUND |
| KWD 2019 | ChEMBL |
| KWD-2019 | ChEMBL |
| NSC-757336 | ChEMBL |
| Terbutaline sulfate | KEGG COMPOUND |
| Terbutaline sulphate | ChEMBL |
| Brand Names | Source |
|---|---|
| Brethaire | ChEMBL |
| Bricanyl | ChEMBL |
| Bricanyl sa | ChEMBL |
| Monovent | ChEMBL |
| Monovent sa | ChEMBL |
| Terbasmin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00688 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:23031-32-5 | KEGG COMPOUND |