EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9449 - terbutaline
| Formula | C12H19NO3 |
| Net Charge | 0 |
| Average Mass | 225.288 |
| Monoisotopic Mass | 225.13649 |
| SMILES | CC(C)(C)NCC(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3 |
| InChIKey | XWTYSIMOBUGWOL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. tocolytic agent Any compound used to suppress premature labour and immature birth by suppressing uterine contractions. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic drug A drug used to treat asthma. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbutaline (CHEBI:9449) has role anti-asthmatic drug (CHEBI:49167) |
| terbutaline (CHEBI:9449) has role bronchodilator agent (CHEBI:35523) |
| terbutaline (CHEBI:9449) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| terbutaline (CHEBI:9449) has role hypoglycemic agent (CHEBI:35526) |
| terbutaline (CHEBI:9449) has role sympathomimetic agent (CHEBI:35524) |
| terbutaline (CHEBI:9449) has role tocolytic agent (CHEBI:66993) |
| terbutaline (CHEBI:9449) has role β-adrenergic agonist (CHEBI:35522) |
| terbutaline (CHEBI:9449) is a phenylethanolamines (CHEBI:25990) |
| terbutaline (CHEBI:9449) is a resorcinols (CHEBI:33572) |
| Incoming Relation(s) |
| bambuterol (CHEBI:553827) has functional parent terbutaline (CHEBI:9449) |
| terbutaline sulfate (CHEBI:9450) has functional parent terbutaline (CHEBI:9449) |
| IUPAC Name |
|---|
| 5-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,3-diol |
| INNs | Source |
|---|---|
| terbutalinum | DrugBank |
| terbutalina | WHO MedNet |
| terbutaline | ChemIDplus |
| terbutaline | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| C07129 | KEGG COMPOUND |
| D08570 | KEGG DRUG |
| DB00871 | DrugBank |
| WO2011112499 | Patent |
| HMDB0015009 | HMDB |
| Terbutaline | Wikipedia |
| 2598 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2370513 | Reaxys |
| CAS:23031-25-6 | KEGG COMPOUND |
| Citations |
|---|