EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO3 |
| Net Charge | 0 |
| Average Mass | 225.288 |
| Monoisotopic Mass | 225.13649 |
| SMILES | CC(C)(C)NCC(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3 |
| InChIKey | XWTYSIMOBUGWOL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. tocolytic agent Any compound used to suppress premature labour and immature birth by suppressing uterine contractions. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. hypoglycemic agent A drug which lowers the blood glucose level. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbutaline (CHEBI:9449) has role anti-asthmatic agent (CHEBI:65023) |
| terbutaline (CHEBI:9449) has role anti-asthmatic drug (CHEBI:49167) |
| terbutaline (CHEBI:9449) has role bronchodilator agent (CHEBI:35523) |
| terbutaline (CHEBI:9449) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| terbutaline (CHEBI:9449) has role hypoglycemic agent (CHEBI:35526) |
| terbutaline (CHEBI:9449) has role sympathomimetic agent (CHEBI:35524) |
| terbutaline (CHEBI:9449) has role tocolytic agent (CHEBI:66993) |
| terbutaline (CHEBI:9449) has role β-adrenergic agonist (CHEBI:35522) |
| terbutaline (CHEBI:9449) is a phenylethanolamines (CHEBI:25990) |
| terbutaline (CHEBI:9449) is a resorcinols (CHEBI:33572) |
| Incoming Relation(s) |
| bambuterol (CHEBI:553827) has functional parent terbutaline (CHEBI:9449) |
| terbutaline sulfate (CHEBI:9450) has functional parent terbutaline (CHEBI:9449) |
| IUPAC Name |
|---|
| 5-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,3-diol |
| INNs | Source |
|---|---|
| terbutalina | WHO MedNet |
| terbutaline | WHO MedNet |
| terbutaline | ChemIDplus |
| terbutalinum | DrugBank |
| Synonym | Source |
|---|---|
| Asthmasian | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2598 | DrugCentral |
| C07129 | KEGG COMPOUND |
| D08570 | KEGG DRUG |
| DB00871 | DrugBank |
| HMDB0015009 | HMDB |
| Terbutaline | Wikipedia |
| WO2011112499 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2370513 | Reaxys |
| CAS:23031-25-6 | KEGG COMPOUND |
| Citations |
|---|