EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23NO6S |
| Net Charge | 0 |
| Average Mass | 477.538 |
| Monoisotopic Mass | 477.12461 |
| SMILES | COC(=O)CCCC1=CC2=CC(=O)C(C)(OC(=O)c3cccs3)C(=O)C2=CN1c1ccccc1 |
| InChI | InChI=1S/C26H23NO6S/c1-26(33-25(31)21-11-7-13-34-21)22(28)15-17-14-19(10-6-12-23(29)32-2)27(16-20(17)24(26)30)18-8-4-3-5-9-18/h3-5,7-9,11,13-16H,6,10,12H2,1-2H3 |
| InChIKey | CEQQMHJEJHSRJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-thiophenecarboxylic acid [3-(4-methoxy-4-oxobutyl)-7-methyl-6,8-dioxo-2-phenyl-7-isoquinolinyl] ester (CHEBI:93867) is a azaphilone (CHEBI:50941) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4441 | LINCS |