EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O9 |
| Net Charge | 0 |
| Average Mass | 466.527 |
| Monoisotopic Mass | 466.22028 |
| SMILES | [H][C@@]12C=C(C)[C@@H](OC(=O)CC(C)C)C[C@]1(COC(C)=O)[C@@]1(C)[C@H](OC(C)=O)[C@@H](O)[C@@]([H])(O2)[C@@]12CO2 |
| InChI | InChI=1S/C24H34O9/c1-12(2)7-18(27)32-16-9-23(10-29-14(4)25)17(8-13(16)3)33-21-19(28)20(31-15(5)26)22(23,6)24(21)11-30-24/h8,12,16-17,19-21,28H,7,9-11H2,1-6H3/t16-,17+,19+,20+,21+,22+,23+,24-/m0/s1 |
| InChIKey | BXFOFFBJRFZBQZ-QYWOHJEZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium graminearum (ncbitaxon:5518) | - | PubMed (16604118) | Strain: Z-3639 |
| Fusarium sporotrichioides (ncbitaxon:5514) | - | PubMed (16604118) | Strain: NRRL3299 |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. mycotoxin Poisonous substance produced by fungi. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| T-2 toxin (CHEBI:9381) has functional parent HT-2 toxin (CHEBI:138861) |
| T-2 toxin (CHEBI:9381) has role apoptosis inducer (CHEBI:68495) |
| T-2 toxin (CHEBI:9381) has role cardiotoxic agent (CHEBI:50912) |
| T-2 toxin (CHEBI:9381) has role DNA synthesis inhibitor (CHEBI:59517) |
| T-2 toxin (CHEBI:9381) has role environmental contaminant (CHEBI:78298) |
| T-2 toxin (CHEBI:9381) has role fungal metabolite (CHEBI:76946) |
| T-2 toxin (CHEBI:9381) has role mycotoxin (CHEBI:25442) |
| T-2 toxin (CHEBI:9381) has role neurotoxin (CHEBI:50910) |
| T-2 toxin (CHEBI:9381) is a acetate ester (CHEBI:47622) |
| T-2 toxin (CHEBI:9381) is a organic heterotetracyclic compound (CHEBI:38163) |
| T-2 toxin (CHEBI:9381) is a trichothecene (CHEBI:55517) |
| IUPAC Name |
|---|
| 4β,15-bis(acetyloxy)-3α-hydroxy-12,13-epoxytrichothec-9-en-8α-yl 3-methylbutanoate |
| Synonyms | Source |
|---|---|
| 3-hydroxy-4,15-diacetoxy-8-(3-methylbutyryloxy)-12,13-epoxy-δ-9-trichothecene | ChemIDplus |
| (3α,4β,8α)-12,13-epoxy-4,15-diacetate 8-(3-methylbutanoate)trichothec-9-ene-3,4,8,15-tetrol | ChEBI |
| 4β,15-diacetoxy-3α-hydroxy-8α-(3-methylbutyryloxy)-12,13-epoxytrichothec-9-ene | ChEBI |
| fusariotoxine T2 | ChemIDplus |
| fusariotoxin T 2 | ChemIDplus |
| fusariotoxin T-2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4447526 | ChemSpider |
| C00003192 | KNApSAcK |
| C09738 | KEGG COMPOUND |
| CPD-18416 | MetaCyc |
| FDB015515 | FooDB |
| HMDB0036600 | HMDB |
| T-2_mycotoxin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3575695 | Reaxys |
| CAS:21259-20-1 | ChemIDplus |
| CAS:21259-20-1 | NIST Chemistry WebBook |
| Citations |
|---|