EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O8 |
| Net Charge | 0 |
| Average Mass | 424.490 |
| Monoisotopic Mass | 424.20972 |
| SMILES | [H][C@@]12C=C(C)[C@@H](OC(=O)CC(C)C)C[C@]1(COC(C)=O)[C@@]1(C)[C@H](O)[C@@H](O)[C@@]([H])(O2)[C@@]12CO2 |
| InChI | InChI=1S/C22H32O8/c1-11(2)6-16(24)29-14-8-21(9-27-13(4)23)15(7-12(14)3)30-19-17(25)18(26)20(21,5)22(19)10-28-22/h7,11,14-15,17-19,25-26H,6,8-10H2,1-5H3/t14-,15+,17+,18+,19+,20+,21+,22-/m0/s1 |
| InChIKey | PNKLMTPXERFKEN-MLXHEQMXSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HT-2 toxin (CHEBI:138861) has role apoptosis inducer (CHEBI:68495) |
| HT-2 toxin (CHEBI:138861) has role fungal metabolite (CHEBI:76946) |
| HT-2 toxin (CHEBI:138861) is a acetate ester (CHEBI:47622) |
| HT-2 toxin (CHEBI:138861) is a organic heterotetracyclic compound (CHEBI:38163) |
| HT-2 toxin (CHEBI:138861) is a trichothecene (CHEBI:55517) |
| Incoming Relation(s) |
| T-2 toxin (CHEBI:9381) has functional parent HT-2 toxin (CHEBI:138861) |
| IUPAC Name |
|---|
| 15-(acetyloxy)-3α,4β-dihydroxy-12,13-epoxytrichothec-9-en-8α-yl 3-methylbutanoate |
| Synonyms | Source |
|---|---|
| HT-2 | ChemIDplus |
| HT 2 toxin | ChemIDplus |
| mycotoxin HT 2 | ChemIDplus |
| mycotoxin HT-2 | ChemIDplus |
| toxin HT 2 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:26934-87-2 | NIST Chemistry WebBook |
| CAS:26934-87-2 | ChemIDplus |
| Citations |
|---|