EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N4O5S |
| Net Charge | 0 |
| Average Mass | 364.383 |
| Monoisotopic Mass | 364.08414 |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C15H16N4O5S/c1-9-8-10(2)17-14(16-9)18-15(21)19-25(22,23)12-7-5-4-6-11(12)13(20)24-3/h4-8H,1-3H3,(H2,16,17,18,19,21) |
| InChIKey | ZDXMLEQEMNLCQG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfometuron methyl (CHEBI:9348) has functional parent sulfometuron (CHEBI:82042) |
| sulfometuron methyl (CHEBI:9348) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| sulfometuron methyl (CHEBI:9348) has role herbicide (CHEBI:24527) |
| sulfometuron methyl (CHEBI:9348) is a N-sulfonylurea (CHEBI:76983) |
| sulfometuron methyl (CHEBI:9348) is a benzoate ester (CHEBI:36054) |
| sulfometuron methyl (CHEBI:9348) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| methyl 2-{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl}benzoate |
| Synonym | Source |
|---|---|
| Sulfometuron-methyl | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1149 | PPDB |
| 1SM | PDBeChem |
| C10955 | KEGG COMPOUND |
| CPD0-1692 | MetaCyc |
| Sulfometuron_methyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:965602 | Reaxys |
| CAS:74222-97-2 | KEGG COMPOUND |
| CAS:74222-97-2 | ChemIDplus |
| Citations |
|---|