EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N4O5S |
| Net Charge | 0 |
| Average Mass | 350.356 |
| Monoisotopic Mass | 350.06849 |
| SMILES | Cc1cc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C14H14N4O5S/c1-8-7-9(2)16-13(15-8)17-14(21)18-24(22,23)11-6-4-3-5-10(11)12(19)20/h3-7H,1-2H3,(H,19,20)(H2,15,16,17,18,21) |
| InChIKey | FZMKKCQHDROFNI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfometuron (CHEBI:82042) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| sulfometuron (CHEBI:82042) has role herbicide (CHEBI:24527) |
| sulfometuron (CHEBI:82042) is a N-sulfonylurea (CHEBI:76983) |
| sulfometuron (CHEBI:82042) is a benzoic acids (CHEBI:22723) |
| sulfometuron (CHEBI:82042) is a monocarboxylic acid (CHEBI:25384) |
| sulfometuron (CHEBI:82042) is a pyrimidines (CHEBI:39447) |
| Incoming Relation(s) |
| sulfometuron methyl (CHEBI:9348) has functional parent sulfometuron (CHEBI:82042) |
| IUPAC Name |
|---|
| 2-{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 2-[[[[(4,6-dimethyl-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoic acid | Alan Wood's Pesticides |
| 2-(3-(4,6-dimethylpyrimidin-2-yl)ureidosulfonyl)benzoic acid | ChemIDplus |
| 2-[3-(4,6-dimethylpyrimidin-2-yl)ureidosulfonyl]benzoic acid | ChEBI |
| sulfométuron | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18895 | KEGG COMPOUND |
| sulfometuron | Alan Wood's Pesticides |
| 47882 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:937935 | Reaxys |
| CAS:74223-56-6 | ChemIDplus |
| Citations |
|---|