EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9337 - sulfathiazole
| Formula | C9H9N3O2S2 |
| Net Charge | 0 |
| Average Mass | 255.324 |
| Monoisotopic Mass | 255.01362 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C9H9N3O2S2/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9/h1-6H,10H2,(H,11,12) |
| InChIKey | JNMRHUJNCSQMMB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. drug allergen Any drug which causes the onset of an allergic reaction. EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfathiazole (CHEBI:9337) has functional parent sulfanilamide (CHEBI:45373) |
| sulfathiazole (CHEBI:9337) has role antiinfective agent (CHEBI:35441) |
| sulfathiazole (CHEBI:9337) has role drug allergen (CHEBI:88188) |
| sulfathiazole (CHEBI:9337) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfathiazole (CHEBI:9337) has role environmental contaminant (CHEBI:78298) |
| sulfathiazole (CHEBI:9337) has role xenobiotic (CHEBI:35703) |
| sulfathiazole (CHEBI:9337) is a 1,3-thiazoles (CHEBI:38418) |
| sulfathiazole (CHEBI:9337) is a substituted aniline (CHEBI:48975) |
| sulfathiazole (CHEBI:9337) is a sulfonamide (CHEBI:35358) |
| sulfathiazole (CHEBI:9337) is a sulfonamide antibiotic (CHEBI:87228) |
| Incoming Relation(s) |
| N-succinylsulfathiazole (CHEBI:9309) has functional parent sulfathiazole (CHEBI:9337) |
| IUPAC Name |
|---|
| 4-amino-N-1,3-thiazol-2-ylbenzenesulfonamide |
| INNs | Source |
|---|---|
| sulfathiazol | ChemIDplus |
| sulfathiazole | KEGG DRUG |
| sulfathiazolum | ChemIDplus |
| Sulfatiazol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(p-Aminobenzenesulfonamido)thiazole | ChemIDplus |
| 2-(p-Aminobenzenesulphonamido)thiazole | ChemIDplus |
| 2-Sulfanilamidothiazol | ChemIDplus |
| 2-Sulfanilamidothiazole | ChemIDplus |
| 2-(Sulfanilylamino)thiazole | ChemIDplus |
| 2-Sulfonamidothiazole | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2527 | DrugCentral |
| C11169 | KEGG COMPOUND |
| D01047 | KEGG DRUG |
| DB06147 | DrugBank |
| GB517272 | Patent |
| HMDB0015619 | HMDB |
| LSM-5327 | LINCS |
| Sulfathiazole | Wikipedia |
| US2362087 | Patent |
| US4665100 | Patent |
| Citations |
|---|