EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9337 - sulfathiazole
| Formula | C9H9N3O2S2 |
| Net Charge | 0 |
| Average Mass | 255.324 |
| Monoisotopic Mass | 255.01362 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C9H9N3O2S2/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9/h1-6H,10H2,(H,11,12) |
| InChIKey | JNMRHUJNCSQMMB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. drug allergen Any drug which causes the onset of an allergic reaction. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfathiazole (CHEBI:9337) has functional parent sulfanilamide (CHEBI:45373) |
| sulfathiazole (CHEBI:9337) has role antiinfective agent (CHEBI:35441) |
| sulfathiazole (CHEBI:9337) has role drug allergen (CHEBI:88188) |
| sulfathiazole (CHEBI:9337) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfathiazole (CHEBI:9337) has role environmental contaminant (CHEBI:78298) |
| sulfathiazole (CHEBI:9337) has role xenobiotic (CHEBI:35703) |
| sulfathiazole (CHEBI:9337) is a 1,3-thiazoles (CHEBI:38418) |
| sulfathiazole (CHEBI:9337) is a substituted aniline (CHEBI:48975) |
| sulfathiazole (CHEBI:9337) is a sulfonamide (CHEBI:35358) |
| sulfathiazole (CHEBI:9337) is a sulfonamide antibiotic (CHEBI:87228) |
| Incoming Relation(s) |
| N-succinylsulfathiazole (CHEBI:9309) has functional parent sulfathiazole (CHEBI:9337) |
| IUPAC Name |
|---|
| 4-amino-N-1,3-thiazol-2-ylbenzenesulfonamide |
| INNs | Source |
|---|---|
| sulfathiazole | KEGG DRUG |
| sulfathiazol | ChemIDplus |
| sulfathiazolum | ChemIDplus |
| Sulfatiazol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(Sulfanilylamino)thiazole | ChemIDplus |
| 2-(p-Aminobenzenesulfonamido)thiazole | ChemIDplus |
| 2-(p-Aminobenzenesulphonamido)thiazole | ChemIDplus |
| 2-Sulfanilamidothiazol | ChemIDplus |
| 2-Sulfanilamidothiazole | ChemIDplus |
| 2-Sulfonamidothiazole | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11169 | KEGG COMPOUND |
| D01047 | KEGG DRUG |
| GB517272 | Patent |
| US2362087 | Patent |
| Sulfathiazole | Wikipedia |
| DB06147 | DrugBank |
| US4665100 | Patent |
| HMDB0015619 | HMDB |
| LSM-5327 | LINCS |
| 2527 | DrugCentral |
| Citations |
|---|