EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N4O5S |
| Net Charge | 0 |
| Average Mass | 398.400 |
| Monoisotopic Mass | 398.06849 |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O |
| InChI | InChI=1S/C18H14N4O5S/c23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17/h1-11,23H,(H,19,22)(H,24,25)/b21-20+ |
| InChIKey | NCEXYHBECQHGNR-QZQOTICOSA-N |
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. drug allergen Any drug which causes the onset of an allergic reaction. EC 2.5.1.18 (glutathione transferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of a glutathione transferase (EC 2.5.1.18). |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfasalazine (CHEBI:9334) has functional parent sulfanilamide (CHEBI:45373) |
| sulfasalazine (CHEBI:9334) has role antiinfective agent (CHEBI:35441) |
| sulfasalazine (CHEBI:9334) has role drug allergen (CHEBI:88188) |
| sulfasalazine (CHEBI:9334) has role EC 2.5.1.18 (glutathione transferase) inhibitor (CHEBI:76797) |
| sulfasalazine (CHEBI:9334) has role ferroptosis inducer (CHEBI:173085) |
| sulfasalazine (CHEBI:9334) has role gastrointestinal drug (CHEBI:55324) |
| sulfasalazine (CHEBI:9334) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| sulfasalazine (CHEBI:9334) is a azobenzenes (CHEBI:22682) |
| sulfasalazine (CHEBI:9334) is a pyridines (CHEBI:26421) |
| sulfasalazine (CHEBI:9334) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 2-hydroxy-5-{[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl}benzoic acid |
| INNs | Source |
|---|---|
| Salazosulfapiridina | ChemIDplus |
| Salazosulfapyridinum | ChemIDplus |
| Sulfasalazina | ChemIDplus |
| sulfasalazine | ChemIDplus |
| Sulfasalazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-5-((4-((2-pyridinylamino)sulfonyl)phenyl)azo)benzoic acid | ChemIDplus |
| 2-Hydroxy-5-[4-(pyridin-2-ylsulfamoyl)-phenylazo]-benzoic acid | ChEMBL |
| 4-(Pyridyl-2-amidosulfonyl)-3'-carboxy-4'-hydroxyazobenzene | ChemIDplus |
| 5-(4-(2-Pyridylsulfamoyl)phenylazo)-2-hydroxybenzoic acid | ChemIDplus |
| 5-((p-(2-Pyridylsulfamoyl)phenyl)azo)salicylic acid | ChemIDplus |
| 5-(p-(2-Pyridylsulfamyl)phenylazo)salicylic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Azulfidine | KEGG DRUG |
| Citations |
|---|