EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N4O5S |
| Net Charge | 0 |
| Average Mass | 398.400 |
| Monoisotopic Mass | 398.06849 |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O |
| InChI | InChI=1S/C18H14N4O5S/c23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17/h1-11,23H,(H,19,22)(H,24,25)/b21-20+ |
| InChIKey | NCEXYHBECQHGNR-QZQOTICOSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.18 (glutathione transferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of a glutathione transferase (EC 2.5.1.18). drug allergen Any drug which causes the onset of an allergic reaction. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antirheumatic drug A drug used to treat rheumatoid arthritis. drug allergen Any drug which causes the onset of an allergic reaction. anti-inflammatory agent Any compound that has anti-inflammatory effects. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfasalazine (CHEBI:9334) has functional parent sulfanilamide (CHEBI:45373) |
| sulfasalazine (CHEBI:9334) has role anti-inflammatory agent (CHEBI:67079) |
| sulfasalazine (CHEBI:9334) has role antiemetic (CHEBI:50919) |
| sulfasalazine (CHEBI:9334) has role antihypertensive agent (CHEBI:35674) |
| sulfasalazine (CHEBI:9334) has role antiinfective agent (CHEBI:35441) |
| sulfasalazine (CHEBI:9334) has role antineoplastic agent (CHEBI:35610) |
| sulfasalazine (CHEBI:9334) has role antirheumatic drug (CHEBI:35842) |
| sulfasalazine (CHEBI:9334) has role drug allergen (CHEBI:88188) |
| sulfasalazine (CHEBI:9334) has role EC 2.5.1.18 (glutathione transferase) inhibitor (CHEBI:76797) |
| sulfasalazine (CHEBI:9334) has role ferroptosis inducer (CHEBI:173085) |
| sulfasalazine (CHEBI:9334) has role gastrointestinal drug (CHEBI:55324) |
| sulfasalazine (CHEBI:9334) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| sulfasalazine (CHEBI:9334) is a azobenzenes (CHEBI:22682) |
| sulfasalazine (CHEBI:9334) is a pyridines (CHEBI:26421) |
| sulfasalazine (CHEBI:9334) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 2-hydroxy-5-{[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl}benzoic acid |
| INNs | Source |
|---|---|
| Salazosulfapiridina | ChemIDplus |
| Salazosulfapyridinum | ChemIDplus |
| Sulfasalazina | ChemIDplus |
| sulfasalazine | ChemIDplus |
| Sulfasalazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-5-((4-((2-pyridinylamino)sulfonyl)phenyl)azo)benzoic acid | ChemIDplus |
| 2-Hydroxy-5-[4-(pyridin-2-ylsulfamoyl)-phenylazo]-benzoic acid | ChEMBL |
| 4-(Pyridyl-2-amidosulfonyl)-3'-carboxy-4'-hydroxyazobenzene | ChemIDplus |
| 5-(4-(2-Pyridylsulfamoyl)phenylazo)-2-hydroxybenzoic acid | ChemIDplus |
| 5-((p-(2-Pyridylsulfamoyl)phenyl)azo)salicylic acid | ChemIDplus |
| 5-(p-(2-Pyridylsulfamyl)phenylazo)salicylic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Azulfidine | KEGG DRUG |
| Azulfidine en-tabs | ChEMBL |
| Colizine | ChEMBL |
| Salazopyrin | ChEMBL |
| Salazopyrin e.c. | ChEMBL |
| Salazopyrin-en | ChEMBL |
| Citations |
|---|