EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9N2O3S.Na |
| Net Charge | 0 |
| Average Mass | 236.228 |
| Monoisotopic Mass | 236.02316 |
| SMILES | CC(=O)[N-]S(=O)(=O)c1ccc(N)cc1.[Na+] |
| InChI | InChI=1S/C8H10N2O3S.Na/c1-6(11)10-14(12,13)8-4-2-7(9)3-5-8;/h2-5H,9H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | PQMSFAORUFMASU-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfacetamide sodium anhydrous (CHEBI:9327) has part sulfacetamide(1−) (CHEBI:63857) |
| sulfacetamide sodium anhydrous (CHEBI:9327) has role antiinfective agent (CHEBI:35441) |
| sulfacetamide sodium anhydrous (CHEBI:9327) has role antimicrobial agent (CHEBI:33281) |
| sulfacetamide sodium anhydrous (CHEBI:9327) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfacetamide sodium anhydrous (CHEBI:9327) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| sulfacetamide sodium (CHEBI:63858) has part sulfacetamide sodium anhydrous (CHEBI:9327) |
| IUPAC Name |
|---|
| sodium acetyl[(4-aminophenyl)sulfonyl]azanide |
| Synonyms | Source |
|---|---|
| N1-acetylsulfanilamide sodium | ChemIDplus |
| N1-acetylsulfanilamide sodium salt | ChemIDplus |
| N-Sulfanilylacetamide, sodium salt | ChemIDplus |
| Sodium N-sulfanilylacetamide | ChemIDplus |
| Sodium sulfacetamide | ChemIDplus |
| Sodium sulfanilylacetamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08051 | KEGG COMPOUND |
| DB00634 | DrugBank |
| US2011223261 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4220398 | Reaxys |
| CAS:127-56-0 | KEGG COMPOUND |
| CAS:127-56-0 | ChemIDplus |
| Citations |
|---|