EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9N2O3S.H2O.Na |
| Net Charge | 0 |
| Average Mass | 254.243 |
| Monoisotopic Mass | 254.03372 |
| SMILES | CC(=O)[N-]S(=O)(=O)c1ccc(N)cc1.O.[Na+] |
| InChI | InChI=1S/C8H10N2O3S.Na.H2O/c1-6(11)10-14(12,13)8-4-2-7(9)3-5-8;;/h2-5H,9H2,1H3,(H,10,11);;1H2/q;+1;/p-1 |
| InChIKey | IHCDKJZZFOUARO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfacetamide sodium (CHEBI:63858) has part sulfacetamide sodium anhydrous (CHEBI:9327) |
| sulfacetamide sodium (CHEBI:63858) has role antiinfective agent (CHEBI:35441) |
| sulfacetamide sodium (CHEBI:63858) has role antimicrobial agent (CHEBI:33281) |
| sulfacetamide sodium (CHEBI:63858) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfacetamide sodium (CHEBI:63858) is a hydrate (CHEBI:35505) |
| sulfacetamide sodium (CHEBI:63858) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium acetyl[(4-aminophenyl)sulfonyl]azanide—water (1/1) |
| Synonyms | Source |
|---|---|
| Sodium Sulfacetamide | DrugBank |
| sulfacetamide sodium hydrate | ChEBI |
| sulfacetamide sodium monohydrate | ChEBI |
| Sulphacetamide Sodium | DrugBank |