EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O3 |
| Net Charge | 0 |
| Average Mass | 174.155 |
| Monoisotopic Mass | 174.03169 |
| SMILES | O=C1CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H6O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-4H,5H2 |
| InChIKey | SLJWCCMDGTZEGQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthalene-1,2,4-trione (CHEBI:93166) is a cyclic ketone (CHEBI:3992) |
| naphthalene-1,2,4-trione (CHEBI:93166) is tautomer of lawsone (CHEBI:44401) |
| Incoming Relation(s) |
| lawsone (CHEBI:44401) is tautomer of naphthalene-1,2,4-trione (CHEBI:93166) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3483 | LINCS |