EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O3 |
| Net Charge | 0 |
| Average Mass | 174.155 |
| Monoisotopic Mass | 174.03169 |
| SMILES | O=C1C=C(O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C10H6O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,12H |
| InChIKey | CSFWPUWCSPOLJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lawsone (CHEBI:44401) has role antifungal agent (CHEBI:35718) |
| lawsone (CHEBI:44401) has role protective agent (CHEBI:50267) |
| lawsone (CHEBI:44401) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| lawsone (CHEBI:44401) is tautomer of naphthalene-1,2,4-trione (CHEBI:93166) |
| Incoming Relation(s) |
| naphthalene-1,2,4-trione (CHEBI:93166) is tautomer of lawsone (CHEBI:44401) |
| IUPAC Name |
|---|
| 2-hydroxynaphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-hydroxy-1,4-naphthalenedione | NIST Chemistry WebBook |
| 2-hydroxy-1,4-naphthoquinone | IUPAC |
| 2-HYDROXYNAPHTHOQUINONE | PDBeChem |
| Henna | ChemIDplus |
| Lawsone | KEGG COMPOUND |