EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H21N5 |
| Net Charge | 0 |
| Average Mass | 415.500 |
| Monoisotopic Mass | 415.17970 |
| SMILES | c1ccc(-c2ccc(CNc3nc(-c4ccccn4)nnc3-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H21N5/c1-3-9-21(10-4-1)22-16-14-20(15-17-22)19-29-27-25(23-11-5-2-6-12-23)31-32-26(30-27)24-13-7-8-18-28-24/h1-18H,19H2,(H,29,30,32) |
| InChIKey | QNRODODTMXCRKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hypoxia-inducible factor pathway activator An activator that activates the hypoxia inducible factor (HIF) pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML228 (CHEBI:92777) has role hypoxia-inducible factor pathway activator (CHEBI:134083) |
| ML228 (CHEBI:92777) is a 1,2,4-triazines (CHEBI:39410) |
| ML228 (CHEBI:92777) is a biphenyls (CHEBI:22888) |
| ML228 (CHEBI:92777) is a pyridines (CHEBI:26421) |
| ML228 (CHEBI:92777) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-([biphenyl]-4-ylmethyl)-6-phenyl-3-(pyridin-2-yl)-1,2,4-triazin-5-amine |
| Synonyms | Source |
|---|---|
| N-([1,1'-biphenyl]-4-ylmethyl)-6-phenyl-3-(pyridin-2-yl)-1,2,4-triazin-5-amine | ChEBI |
| ML-228 | ChEBI |
| LSM-2978 | LINCS |
| ML228 probe | ChEBI |
| 6-phenyl-N-[(4-phenylphenyl)methyl]-3-(2-pyridinyl)-1,2,4-triazin-5-amine | LINCS |
| Manual Xrefs | Databases |
|---|---|
| LSM-2978 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22196087 | Reaxys |
| Citations |
|---|