EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O2 |
| Net Charge | 0 |
| Average Mass | 284.314 |
| Monoisotopic Mass | 284.08373 |
| SMILES | O=C1C=CC(=O)C2=C1C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C20H12O2/c21-15-9-10-16(22)20-18-12-6-2-1-5-11(12)17(19(15)20)13-7-3-4-8-14(13)18/h1-10,17-18H |
| InChIKey | GCHPUOHXXCNSQL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| INCA-6 (CHEBI:92582) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| INCA-6 (CHEBI:92582) is a organic heteropentacyclic compound (CHEBI:38164) |
| INCA-6 (CHEBI:92582) is a quinone (CHEBI:36141) |
| IUPAC Name |
|---|
| pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9,11,13,15,17,19-octaene-3,6-dione |
| Synonyms | Source |
|---|---|
| 12,15-dihydro-12,15-dioxotriptycene | ChEBI |
| 1,4-triptycenoquinone | ChEBI |
| 9,10-[1,2]-benzenoanthracene-13,16(9H,10H)-dione | ChEBI |
| 9,10-dihydro-9,10-[1',2']benzenoanthracene-1,4-dione | ChEBI |
| 9,10-dihydro-9,10[1',2']-benzenoanthracene-1,4-dione | ChEBI |
| 9,10-dihydro-9,10-o-benzenoanthracene-1,4-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-2729 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:3519-82-2 | ChEBI |
| Citations |
|---|