EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O8 |
| Net Charge | 0 |
| Average Mass | 520.663 |
| Monoisotopic Mass | 520.30362 |
| SMILES | CO[C@H]1CCCC[C@@H](c2ccccc2)OC(=O)[C@@H](C)[C@@]2(O)O[C@H]([C@@H](C)[C@H](O)[C@H]2OC)[C@@H](C)/C=C/[C@H]1OC |
| InChI | InChI=1S/C29H44O8/c1-18-16-17-24(34-5)23(33-4)15-11-10-14-22(21-12-8-7-9-13-21)36-28(31)20(3)29(32)27(35-6)25(30)19(2)26(18)37-29/h7-9,12-13,16-20,22-27,30,32H,10-11,14-15H2,1-6H3/b17-16+/t18-,19-,20+,22-,23-,24+,25-,26-,27+,29+/m0/s1 |
| InChIKey | WPMGNXPRKGXGBO-OFQQMTDKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium cellulosum So ce56 (ncbitaxon:448385) | - | PubMed (7916271) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soraphen A (CHEBI:9200) has role bacterial metabolite (CHEBI:76969) |
| soraphen A (CHEBI:9200) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| soraphen A (CHEBI:9200) has role teratogenic agent (CHEBI:50905) |
| soraphen A (CHEBI:9200) is a cyclic hemiketal (CHEBI:59780) |
| soraphen A (CHEBI:9200) is a ether (CHEBI:25698) |
| soraphen A (CHEBI:9200) is a macrolide (CHEBI:25106) |
| soraphen A (CHEBI:9200) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (1R,2S,5S,10S,11R,12E,14S,15S,16S,17S,18R)-1,17-dihydroxy-10,11,18-trimethoxy-2,14,16-trimethyl-5-phenyl-4,19-dioxabicyclo[13.3.1]nonadec-12-en-3-one |
| Citations |
|---|