EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O8 |
| Net Charge | 0 |
| Average Mass | 520.663 |
| Monoisotopic Mass | 520.30362 |
| SMILES | CO[C@H]1CCCC[C@@H](c2ccccc2)OC(=O)[C@@H](C)[C@@]2(O)O[C@H]([C@@H](C)[C@H](O)[C@H]2OC)[C@@H](C)/C=C/[C@H]1OC |
| InChI | InChI=1S/C29H44O8/c1-18-16-17-24(34-5)23(33-4)15-11-10-14-22(21-12-8-7-9-13-21)36-28(31)20(3)29(32)27(35-6)25(30)19(2)26(18)37-29/h7-9,12-13,16-20,22-27,30,32H,10-11,14-15H2,1-6H3/b17-16+/t18-,19-,20+,22-,23-,24+,25-,26-,27+,29+/m0/s1 |
| InChIKey | WPMGNXPRKGXGBO-OFQQMTDKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium cellulosum So ce56 (ncbitaxon:448385) | - | PubMed (7916271) |
| Roles Classification |
|---|
| Biological Roles: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soraphen A (CHEBI:9200) has role bacterial metabolite (CHEBI:76969) |
| soraphen A (CHEBI:9200) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| soraphen A (CHEBI:9200) has role teratogenic agent (CHEBI:50905) |
| soraphen A (CHEBI:9200) is a cyclic hemiketal (CHEBI:59780) |
| soraphen A (CHEBI:9200) is a ether (CHEBI:25698) |
| soraphen A (CHEBI:9200) is a macrolide (CHEBI:25106) |
| soraphen A (CHEBI:9200) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (1R,2S,5S,10S,11R,12E,14S,15S,16S,17S,18R)-1,17-dihydroxy-10,11,18-trimethoxy-2,14,16-trimethyl-5-phenyl-4,19-dioxabicyclo[13.3.1]nonadec-12-en-3-one |
| Citations |
|---|