EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O |
| Net Charge | 0 |
| Average Mass | 218.340 |
| Monoisotopic Mass | 218.16707 |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C1)C(C)=CC(=O)C[C@H]2C |
| InChI | InChI=1S/C15H22O/c1-10(2)13-5-6-15(9-13)11(3)7-14(16)8-12(15)4/h7,12-13H,1,5-6,8-9H2,2-4H3/t12-,13-,15-/m1/s1 |
| InChIKey | FGCUSSRGQNHZRW-UMVBOHGHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Roles: | phytoalexin A toxin made by a plant that acts against an organism attacking it. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| solavetivone (CHEBI:9192) has role phytoalexin (CHEBI:26115) |
| solavetivone (CHEBI:9192) has role plant metabolite (CHEBI:76924) |
| solavetivone (CHEBI:9192) is a cyclic ketone (CHEBI:3992) |
| solavetivone (CHEBI:9192) is a sesquiterpenoid (CHEBI:26658) |
| solavetivone (CHEBI:9192) is a spiro compound (CHEBI:33599) |
| Incoming Relation(s) |
| 15-hydroxysolavetivone (CHEBI:85159) has functional parent solavetivone (CHEBI:9192) |
| IUPAC Name |
|---|
| (2R,5S,10R)-6,10-dimethyl-2-(prop-1-en-2-yl)spiro[4.5]dec-6-en-8-one |
| Synonyms | Source |
|---|---|
| (−)-(2R,5S,10R)-2-isopropenyl-6,10-dimethylspiro[4.5]dec-6-en-8-one | ChEBI |
| katahdinone | ChemIDplus |
| (−)-solavetivone | ChemIDplus |
| Solavetivone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| solavetivone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1911510 | Reaxys |
| CAS:54878-25-0 | KEGG COMPOUND |
| CAS:54878-25-0 | ChemIDplus |
| Citations |
|---|