EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C1)C(CO)=CC(=O)C[C@H]2C |
| InChI | InChI=1S/C15H22O2/c1-10(2)12-4-5-15(8-12)11(3)6-14(17)7-13(15)9-16/h7,11-12,16H,1,4-6,8-9H2,2-3H3/t11-,12-,15+/m1/s1 |
| InChIKey | JPVDGXUSNAEUIC-JMSVASOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-hydroxysolavetivone (CHEBI:85159) has functional parent solavetivone (CHEBI:9192) |
| 15-hydroxysolavetivone (CHEBI:85159) has role plant metabolite (CHEBI:76924) |
| 15-hydroxysolavetivone (CHEBI:85159) is a cyclic ketone (CHEBI:3992) |
| 15-hydroxysolavetivone (CHEBI:85159) is a primary alcohol (CHEBI:15734) |
| 15-hydroxysolavetivone (CHEBI:85159) is a sesquiterpenoid (CHEBI:26658) |
| 15-hydroxysolavetivone (CHEBI:85159) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| (2R,5S,10R)-6-(hydroxymethyl)-10-methyl-2-(prop-1-en-2-yl)spiro[4.5]dec-6-en-8-one |
| Synonym | Source |
|---|---|
| oxysolavetivone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034956 | HMDB |
| CPD-4741 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5535361 | Reaxys |