EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO |
| Net Charge | 0 |
| Average Mass | 397.647 |
| Monoisotopic Mass | 397.33446 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])N3C[C@@H](C)CC[C@]3([H])[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H43NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-25,29H,5,7-15H2,1-4H3/t16-,17+,19-,20+,21-,22-,23+,24-,25-,26-,27-/m0/s1 |
| InChIKey | JVKYZPBMZPJNAJ-OQFNDJACSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (6686191) | |
| Solanum tuberosum (ncbitaxon:4113) | - | PubMed (32587595) | Identified in the root exudate. |
| Solanum viarum (ncbitaxon:215581) | - | PubMed (31814043) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| solanidine (CHEBI:28374) has role plant metabolite (CHEBI:76924) |
| solanidine (CHEBI:28374) has role toxin (CHEBI:27026) |
| solanidine (CHEBI:28374) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| solanidine (CHEBI:28374) is a solanid-5-en-3-ol (CHEBI:180936) |
| solanidine (CHEBI:28374) is a steroid alkaloid fundamental parent (CHEBI:38516) |
| solanidine (CHEBI:28374) is conjugate base of solanidine(1+) (CHEBI:166996) |
| Incoming Relation(s) |
| solanine (CHEBI:9188) has functional parent solanidine (CHEBI:28374) |
| γ-chaconine(1+) (CHEBI:166997) has functional parent solanidine (CHEBI:28374) |
| solanidine(1+) (CHEBI:166996) is conjugate acid of solanidine (CHEBI:28374) |
| IUPAC Name |
|---|
| solanid-5-en-3β-ol |
| Synonyms | Source |
|---|---|
| (22R,25S)-solanidanine | ChemIDplus |
| (22R,25S)-solanidine | ChemIDplus |
| (2S,4aR,4bS,6aS,6bR,7S,7aR,10S,12aS,13aS,13bS)-4a,6a,7,10-tetramethyl-2,3,4,4a,4b,5,6,6a,6b,7,7a,8,9,10,11,12a,13,13a,13b,14-icosahydro-1H-naphtho[2',1':4,5]indeno[1,2-b]indolizin-2-ol | ChEBI |
| 3-beta-solanid-5-en-3-ol | HMDB |
| (3β)-solanid-5-en-3-ol | ChemIDplus |
| (3β)-solanid-5-en-3-ol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 59150 | ChemSpider |
| C00002261 | KNApSAcK |
| C06543 | KEGG COMPOUND |
| FDB012098 | FooDB |
| HMDB0003236 | HMDB |
| LMST01150007 | LIPID MAPS |
| Solanidine | Wikipedia |
| Citations |
|---|