EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO |
| Net Charge | 0 |
| Average Mass | 397.647 |
| Monoisotopic Mass | 397.33446 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])N3C[C@@H](C)CC[C@]3([H])[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H43NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-25,29H,5,7-15H2,1-4H3/t16-,17+,19-,20+,21-,22-,23+,24-,25-,26-,27-/m0/s1 |
| InChIKey | JVKYZPBMZPJNAJ-OQFNDJACSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (6686191) | |
| Solanum tuberosum (ncbitaxon:4113) | - | PubMed (32587595) | Identified in the root exudate. |
| Solanum viarum (ncbitaxon:215581) | - | PubMed (31814043) |
| Roles Classification |
|---|
| Biological Roles: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| solanidine (CHEBI:28374) has role plant metabolite (CHEBI:76924) |
| solanidine (CHEBI:28374) has role toxin (CHEBI:27026) |
| solanidine (CHEBI:28374) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| solanidine (CHEBI:28374) is a solanid-5-en-3-ol (CHEBI:180936) |
| solanidine (CHEBI:28374) is a steroid alkaloid fundamental parent (CHEBI:38516) |
| solanidine (CHEBI:28374) is conjugate base of solanidine(1+) (CHEBI:166996) |
| Incoming Relation(s) |
| solanine (CHEBI:9188) has functional parent solanidine (CHEBI:28374) |
| γ-chaconine(1+) (CHEBI:166997) has functional parent solanidine (CHEBI:28374) |
| solanidine(1+) (CHEBI:166996) is conjugate acid of solanidine (CHEBI:28374) |
| IUPAC Name |
|---|
| solanid-5-en-3β-ol |
| Synonyms | Source |
|---|---|
| solanidine | KEGG COMPOUND |
| (3β)-solanid-5-en-3-ol | ChemIDplus |
| (3β)-solanid-5-en-3-ol | NIST Chemistry WebBook |
| 3-beta-solanid-5-en-3-ol | HMDB |
| (2S,4aR,4bS,6aS,6bR,7S,7aR,10S,12aS,13aS,13bS)-4a,6a,7,10-tetramethyl-2,3,4,4a,4b,5,6,6a,6b,7,7a,8,9,10,11,12a,13,13a,13b,14-icosahydro-1H-naphtho[2',1':4,5]indeno[1,2-b]indolizin-2-ol | ChEBI |
| (22R,25S)-solanidanine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06543 | KEGG COMPOUND |
| LMST01150007 | LIPID MAPS |
| Solanidine | Wikipedia |
| HMDB0003236 | HMDB |
| C00002261 | KNApSAcK |
| FDB012098 | FooDB |
| 59150 | ChemSpider |
| Citations |
|---|