EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO |
| Net Charge | 0 |
| Average Mass | 397.647 |
| Monoisotopic Mass | 397.33446 |
| SMILES | [H][C@@]12CC=C3CC(O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])N3C[C@@H](C)CC[C@]3([H])[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H43NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-25,29H,5,7-15H2,1-4H3/t16-,17+,19?,20+,21-,22-,23+,24-,25-,26-,27-/m0/s1 |
| InChIKey | JVKYZPBMZPJNAJ-DZMCFCHHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| solanid-5-en-3-ol (CHEBI:180936) is a 3-hydroxy steroid (CHEBI:36834) |
| solanid-5-en-3-ol (CHEBI:180936) is a alkaloid (CHEBI:22315) |
| solanid-5-en-3-ol (CHEBI:180936) is a organic heterohexacyclic compound (CHEBI:51914) |
| Incoming Relation(s) |
| solanidine (CHEBI:28374) is a solanid-5-en-3-ol (CHEBI:180936) |
| IUPAC Name |
|---|
| solanid-5-en-3-ol |
| Synonym | Source |
|---|---|
| (4aR,4bS,6aS,6bR,7S,7aR,10S,12aS,13aS,13bS)-4a,6a,7,10-tetramethyl-2,3,4,4a,4b,5,6,6a,6b,7,7a,8,9,10,11,12a,13,13a,13b,14-icosahydro-1H-naphtho[2',1':4,5]indeno[1,2-b]indolizin-2-ol | IUPAC |