EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H79NO13 |
| Net Charge | 0 |
| Average Mass | 914.187 |
| Monoisotopic Mass | 913.55514 |
| SMILES | [H][C@@]1(C[C@@H](C)[C@]2([H])CC(=O)[C@H](C)/C=C(\C)[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)[C@@H](OC)C[C@]3([H])CC[C@@H](C)[C@@](O)(O3)C(=O)C(=O)N3CCCC[C@@]3([H])C(=O)O2)CC[C@@H](O)[C@H](OC)C1 |
| InChI | InChI=1S/C51H79NO13/c1-30-16-12-11-13-17-31(2)42(61-8)28-38-21-19-36(7)51(60,65-38)48(57)49(58)52-23-15-14-18-39(52)50(59)64-43(33(4)26-37-20-22-40(53)44(27-37)62-9)29-41(54)32(3)25-35(6)46(56)47(63-10)45(55)34(5)24-30/h11-13,16-17,25,30,32-34,36-40,42-44,46-47,53,56,60H,14-15,18-24,26-29H2,1-10H3/b13-11+,16-12+,31-17+,35-25+/t30-,32-,33-,34-,36-,37+,38+,39+,40-,42+,43+,44-,46-,47+,51-/m1/s1 |
| InChIKey | QFJCIRLUMZQUOT-HPLJOQBZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces hygroscopicus (ncbitaxon:1912) | - | PubMed (21438579) |
| Roles Classification |
|---|
| Biological Roles: | mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antibacterial drug A drug used to treat or prevent bacterial infections. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antibacterial drug A drug used to treat or prevent bacterial infections. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sirolimus (CHEBI:9168) has role antibacterial drug (CHEBI:36047) |
| sirolimus (CHEBI:9168) has role anticoronaviral agent (CHEBI:149553) |
| sirolimus (CHEBI:9168) has role antineoplastic agent (CHEBI:35610) |
| sirolimus (CHEBI:9168) has role bacterial metabolite (CHEBI:76969) |
| sirolimus (CHEBI:9168) has role geroprotector (CHEBI:176497) |
| sirolimus (CHEBI:9168) has role immunosuppressive agent (CHEBI:35705) |
| sirolimus (CHEBI:9168) has role mTOR inhibitor (CHEBI:68481) |
| sirolimus (CHEBI:9168) is a antibiotic antifungal drug (CHEBI:87113) |
| sirolimus (CHEBI:9168) is a cyclic acetal (CHEBI:59770) |
| sirolimus (CHEBI:9168) is a cyclic ketone (CHEBI:3992) |
| sirolimus (CHEBI:9168) is a ether (CHEBI:25698) |
| sirolimus (CHEBI:9168) is a macrolide lactam (CHEBI:145565) |
| sirolimus (CHEBI:9168) is a organic heterotricyclic compound (CHEBI:26979) |
| sirolimus (CHEBI:9168) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| everolimus (CHEBI:68478) has functional parent sirolimus (CHEBI:9168) |
| ridaforolimus (CHEBI:82677) has functional parent sirolimus (CHEBI:9168) |
| IUPAC Name |
|---|
| (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,27-dihydroxy-3-{(2R)-1-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]propan-2-yl}-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-hexadecahydro-3H-23,27-epoxypyrido[2,1-c][1,4]oxazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| INNs | Source |
|---|---|
| sirolimus | WHO MedNet |
| sirolimus | WHO MedNet |
| sirolimús | WHO MedNet |
| sirolimusum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1R,9S,12S,15R,16E,18R,19R,21R,23S,24E,26E,28E,30S,32S,35R)-1,18-dihydroxy-12-{(2S)-1-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]propan-2-yl}-19,30-dimethoxy-15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraene-2,3,10,14,20-pentone | IUPAC |
| Antibiotic AY 22989 | DrugBank |
| rapamycin | ChEBI |
| (-)-Rapamycin | ChemIDplus |
| Sirolimus | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Rapamune | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2446 | DrugCentral |
| C00018055 | KNApSAcK |
| C07909 | KEGG COMPOUND |
| D00753 | KEGG DRUG |
| DB00877 | DrugBank |
| HMDB0015015 | HMDB |
| LMPK06000003 | LIPID MAPS |
| RAP | PDBeChem |
| Rapamycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5848501 | Reaxys |
| CAS:53123-88-9 | KEGG COMPOUND |
| CAS:53123-88-9 | ChemIDplus |
| Citations |
|---|