EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H83NO14 |
| Net Charge | 0 |
| Average Mass | 958.240 |
| Monoisotopic Mass | 957.58136 |
| SMILES | [H][C@@]1(C[C@@H](C)[C@]2([H])CC(=O)[C@H](C)/C=C(\C)[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)[C@@H](OC)C[C@]3([H])CC[C@@H](C)[C@@](O)(O3)C(=O)C(=O)N3CCCC[C@@]3([H])C(=O)O2)CC[C@@H](OCCO)[C@H](OC)C1 |
| InChI | InChI=1S/C53H83NO14/c1-32-16-12-11-13-17-33(2)44(63-8)30-40-21-19-38(7)53(62,68-40)50(59)51(60)54-23-15-14-18-41(54)52(61)67-45(35(4)28-39-20-22-43(66-25-24-55)46(29-39)64-9)31-42(56)34(3)27-37(6)48(58)49(65-10)47(57)36(5)26-32/h11-13,16-17,27,32,34-36,38-41,43-46,48-49,55,58,62H,14-15,18-26,28-31H2,1-10H3/b13-11+,16-12+,33-17+,37-27+/t32-,34-,35-,36-,38-,39+,40+,41+,43-,44+,45+,46-,48-,49+,53-/m1/s1 |
| InChIKey | HKVAMNSJSFKALM-GKUWKFKPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| everolimus (CHEBI:68478) has functional parent sirolimus (CHEBI:9168) |
| everolimus (CHEBI:68478) has role anticoronaviral agent (CHEBI:149553) |
| everolimus (CHEBI:68478) has role antineoplastic agent (CHEBI:35610) |
| everolimus (CHEBI:68478) has role geroprotector (CHEBI:176497) |
| everolimus (CHEBI:68478) has role immunosuppressive agent (CHEBI:35705) |
| everolimus (CHEBI:68478) has role mTOR inhibitor (CHEBI:68481) |
| everolimus (CHEBI:68478) is a cyclic acetal (CHEBI:59770) |
| everolimus (CHEBI:68478) is a cyclic ketone (CHEBI:3992) |
| everolimus (CHEBI:68478) is a ether (CHEBI:25698) |
| everolimus (CHEBI:68478) is a macrolide lactam (CHEBI:145565) |
| everolimus (CHEBI:68478) is a primary alcohol (CHEBI:15734) |
| everolimus (CHEBI:68478) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,27-dihydroxy-3-{(2R)-1-[(1S,3R,4R)-4-(2-hydroxyethoxy)-3-methoxycyclohexyl]propan-2-yl}-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-hexadecahydro-3H-23,27-epoxypyrido[2,1-c][1,4]oxazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| INNs | Source |
|---|---|
| everolimus | WHO MedNet |
| everolimus | WHO MedNet |
| évérolimus | WHO MedNet |
| everolimusum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1R,9S,12S,15R,16E,18R,19R,21R,23S,24E,26E,28E,30S,35R)-1,18-dihydroxy-12-{(2R)-1-[(1S,3R,4R)-4-(2-hydroxyethoxy)-3-methoxycyclohexyl]propan-2-yl}-19,30-dimethoxy-15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraene-2,3,10,14,20-pentone | IUPAC |
| 40-O-(2-hydroxyethyl)-rapamycin | ChemIDplus |
| 42-O-(2-hydroxyethyl)rapamycin | ChemIDplus |
| Everolimus | ChemIDplus |
| RAD 001 | ChemIDplus |
| RAD001 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Afinitor | ChemIDplus |
| Afinitor Disperz | ChemIDplus |
| Certican | ChemIDplus |
| Votubia | DrugCentral |
| Xience V | ChemIDplus |
| Zortress | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1118 | DrugCentral |
| 21106307 | ChemSpider |
| CN102138903 | Patent |
| D02714 | KEGG DRUG |
| DB01590 | DrugBank |
| Everolimus | Wikipedia |
| HMDB0015529 | HMDB |
| LSM-43172 | LINCS |
| RU2008143550 | Patent |
| WO2012066502 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:159351-69-6 | ChemIDplus |
| Citations |
|---|