EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H83NO14 |
| Net Charge | 0 |
| Average Mass | 958.240 |
| Monoisotopic Mass | 957.58136 |
| SMILES | [H][C@@]1(C[C@@H](C)[C@]2([H])CC(=O)[C@H](C)/C=C(\C)[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)[C@@H](OC)C[C@]3([H])CC[C@@H](C)[C@@](O)(O3)C(=O)C(=O)N3CCCC[C@@]3([H])C(=O)O2)CC[C@@H](OCCO)[C@H](OC)C1 |
| InChI | InChI=1S/C53H83NO14/c1-32-16-12-11-13-17-33(2)44(63-8)30-40-21-19-38(7)53(62,68-40)50(59)51(60)54-23-15-14-18-41(54)52(61)67-45(35(4)28-39-20-22-43(66-25-24-55)46(29-39)64-9)31-42(56)34(3)27-37(6)48(58)49(65-10)47(57)36(5)26-32/h11-13,16-17,27,32,34-36,38-41,43-46,48-49,55,58,62H,14-15,18-26,28-31H2,1-10H3/b13-11+,16-12+,33-17+,37-27+/t32-,34-,35-,36-,38-,39+,40+,41+,43-,44+,45+,46-,48-,49+,53-/m1/s1 |
| InChIKey | HKVAMNSJSFKALM-GKUWKFKPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| everolimus (CHEBI:68478) has functional parent sirolimus (CHEBI:9168) |
| everolimus (CHEBI:68478) has role anticoronaviral agent (CHEBI:149553) |
| everolimus (CHEBI:68478) has role antineoplastic agent (CHEBI:35610) |
| everolimus (CHEBI:68478) has role geroprotector (CHEBI:176497) |
| everolimus (CHEBI:68478) has role immunosuppressive agent (CHEBI:35705) |
| everolimus (CHEBI:68478) has role mTOR inhibitor (CHEBI:68481) |
| everolimus (CHEBI:68478) is a cyclic acetal (CHEBI:59770) |
| everolimus (CHEBI:68478) is a cyclic ketone (CHEBI:3992) |
| everolimus (CHEBI:68478) is a ether (CHEBI:25698) |
| everolimus (CHEBI:68478) is a macrolide lactam (CHEBI:145565) |
| everolimus (CHEBI:68478) is a primary alcohol (CHEBI:15734) |
| everolimus (CHEBI:68478) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,27-dihydroxy-3-{(2R)-1-[(1S,3R,4R)-4-(2-hydroxyethoxy)-3-methoxycyclohexyl]propan-2-yl}-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-hexadecahydro-3H-23,27-epoxypyrido[2,1-c][1,4]oxazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| INNs | Source |
|---|---|
| everolimus | WHO MedNet |
| everolimus | WHO MedNet |
| évérolimus | WHO MedNet |
| everolimusum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1R,9S,12S,15R,16E,18R,19R,21R,23S,24E,26E,28E,30S,35R)-1,18-dihydroxy-12-{(2R)-1-[(1S,3R,4R)-4-(2-hydroxyethoxy)-3-methoxycyclohexyl]propan-2-yl}-19,30-dimethoxy-15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraene-2,3,10,14,20-pentone | IUPAC |
| 40-O-(2-hydroxyethyl)-rapamycin | ChemIDplus |
| 42-O-(2-hydroxyethyl)rapamycin | ChemIDplus |
| Everolimus | ChemIDplus |
| RAD 001 | ChemIDplus |
| RAD001 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Afinitor | ChemIDplus |
| Afinitor Disperz | ChemIDplus |
| Certican | ChemIDplus |
| Votubia | DrugCentral |
| Xience V | ChemIDplus |
| Zortress | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1118 | DrugCentral |
| 21106307 | ChemSpider |
| CN102138903 | Patent |
| D02714 | KEGG DRUG |
| DB01590 | DrugBank |
| Everolimus | Wikipedia |
| HMDB0015529 | HMDB |
| LSM-43172 | LINCS |
| RU2008143550 | Patent |
| WO2012066502 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:159351-69-6 | ChemIDplus |
| Citations |
|---|