EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NOS |
| Net Charge | 0 |
| Average Mass | 337.573 |
| Monoisotopic Mass | 337.24394 |
| SMILES | CCCCCCCCNC(C)C(O)c1ccc(SC(C)C)cc1 |
| InChI | InChI=1S/C20H35NOS/c1-5-6-7-8-9-10-15-21-17(4)20(22)18-11-13-19(14-12-18)23-16(2)3/h11-14,16-17,20-22H,5-10,15H2,1-4H3 |
| InChIKey | BFCDFTHTSVTWOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suloctidil (CHEBI:91639) has role cardiovascular drug (CHEBI:35554) |
| suloctidil (CHEBI:91639) is a amino alcohol (CHEBI:22478) |
| suloctidil (CHEBI:91639) is a aryl sulfide (CHEBI:35683) |
| suloctidil (CHEBI:91639) is a benzenes (CHEBI:22712) |
| suloctidil (CHEBI:91639) is a secondary alcohol (CHEBI:35681) |
| suloctidil (CHEBI:91639) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| (1R,2S)-suloctidil (CHEBI:233451) is a suloctidil (CHEBI:91639) |
| (1S,2R)-suloctidil (CHEBI:233450) is a suloctidil (CHEBI:91639) |
| IUPAC Name |
|---|
| 2-(octylamino)-1-[4-(propan-2-ylsulfanyl)phenyl]propan-1-ol |
| Synonyms | Source |
|---|---|
| 1-(4-isopropylthiophenyl)-2-n-octylaminopropanol | ChEBI |
| 1-(4-isopropylthiophenyl)-2-octylaminopropanol | ChEBI |
| 2-(octylamino)-1-(4-propan-2-ylsulfanylphenyl)propan-1-ol | ChEBI |
| 2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]-1-propanol | ChEBI |
| 2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]propan-1-ol | IUPAC |
| 4-[(1-methylethyl)thio]-α-[1-(octylamino)ethyl]benzenemethanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:54063-56-8 | NIST Chemistry WebBook |
| Citations |
|---|