EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NOS |
| Net Charge | 0 |
| Average Mass | 337.573 |
| Monoisotopic Mass | 337.24394 |
| SMILES | CCCCCCCCN[C@H](C)[C@@H](O)c1ccc(SC(C)C)cc1 |
| InChI | InChI=1S/C20H35NOS/c1-5-6-7-8-9-10-15-21-17(4)20(22)18-11-13-19(14-12-18)23-16(2)3/h11-14,16-17,20-22H,5-10,15H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | BFCDFTHTSVTWOG-YLJYHZDGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-suloctidil (CHEBI:233450) is a suloctidil (CHEBI:91639) |
| Incoming Relation(s) |
| (±)-suloctidil (CHEBI:233445) has part (1S,2R)-suloctidil (CHEBI:233450) |
| IUPAC Name |
|---|
| (1S,2R)-2-(octylamino)-1-[4-(propan-2-ylsulfanyl)phenyl]propan-1-ol |
| Synonyms | Source |
|---|---|
| (1S,2R)-2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]-1-propanol | ChEBI |
| (1S,2R)-2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]propan-1-ol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| LSM-2946 | LINCS |