EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H10O7 |
| Net Charge | 0 |
| Average Mass | 338.271 |
| Monoisotopic Mass | 338.04265 |
| SMILES | O=C1c2cc(O)cc(O)c2C(=O)c2c1cc1cc(O)cc(O)c1c2O |
| InChI | InChI=1S/C18H10O7/c19-7-1-6-2-9-15(17(24)13(6)11(21)4-7)18(25)14-10(16(9)23)3-8(20)5-12(14)22/h1-5,19-22,24H |
| InChIKey | CGFVUVWMYIHGHS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saintopin (CHEBI:91276) has role antineoplastic agent (CHEBI:35610) |
| saintopin (CHEBI:91276) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| saintopin (CHEBI:91276) has role fungal metabolite (CHEBI:76946) |
| saintopin (CHEBI:91276) has role intercalator (CHEBI:24853) |
| saintopin (CHEBI:91276) is a tetracenequinones (CHEBI:51286) |
| IUPAC Name |
|---|
| 1,3,8,10,11-pentahydroxytetracene-5,12-dione |
| Synonym | Source |
|---|---|
| 1,3,8,10,11-pentahydroxy-5,12-naphthacenedione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6664222 | Reaxys |
| CAS:131190-63-1 | ChemIDplus |
| Citations |
|---|