EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(CCCC(=O)O)OO |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(24-23)17-15-18-20(21)22/h6-7,9-10,12-14,16,19,23H,2-5,8,11,15,17-18H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-14+ |
| InChIKey | JNUUNUQHXIOFDA-XTDASVJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10542053) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-HPETE (CHEBI:91268) has role human xenobiotic metabolite (CHEBI:76967) |
| 5-HPETE (CHEBI:91268) is a HPETE (CHEBI:24644) |
| 5-HPETE (CHEBI:91268) is conjugate acid of 5-HPETE(1−) (CHEBI:90822) |
| Incoming Relation(s) |
| 5(S)-HPETE (CHEBI:15632) is a 5-HPETE (CHEBI:91268) |
| 5-HPETE(1−) (CHEBI:90822) is conjugate base of 5-HPETE (CHEBI:91268) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,14Z)-5-hydroperoxyicosa-6,8,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 5-hydroperoxy-(6E,8Z,11Z,14Z)-eicosatetraenoic acid | ChEBI |
| (6E,8Z,11Z,14Z)-5-hydroperoxyicosatetraenoic acid | ChEBI |
| 5-hydroperoxy-(6E,8Z,11Z,14Z)-icosatetraenoic acid | ChEBI |
| Arachidonic acid 5-hydroperoxide | ChemIDplus |
| 6,8,11,14-Eicosatetraenoic acid 5-hydroperoxide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4482926 | Reaxys |
| CAS:74581-83-2 | ChemIDplus |
| Citations |
|---|