EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O4 |
| Net Charge | -1 |
| Average Mass | 335.464 |
| Monoisotopic Mass | 335.22278 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(CCCC(=O)[O-])OO |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(24-23)17-15-18-20(21)22/h6-7,9-10,12-14,16,19,23H,2-5,8,11,15,17-18H2,1H3,(H,21,22)/p-1/b7-6-,10-9-,13-12-,16-14+ |
| InChIKey | JNUUNUQHXIOFDA-XTDASVJISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10542053) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-HPETE(1−) (CHEBI:90822) has role human xenobiotic metabolite (CHEBI:76967) |
| 5-HPETE(1−) (CHEBI:90822) is a HPETE anion (CHEBI:59720) |
| 5-HPETE(1−) (CHEBI:90822) is conjugate base of 5-HPETE (CHEBI:91268) |
| Incoming Relation(s) |
| 5(R)-HPETE(1−) (CHEBI:193570) is a 5-HPETE(1−) (CHEBI:90822) |
| 5-HPETE (CHEBI:91268) is conjugate acid of 5-HPETE(1−) (CHEBI:90822) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,14Z)-5-hydroperoxyicosa-6,8,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| 5-hydroperoxy-(6E,8Z,11Z,14Z)-icosatetraenoate | ChEBI |
| (6E,8Z,11Z,14Z)-5-hydroperoxyicosatetraenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-hydroperoxy-(6E,8Z,11Z,14Z)-eicosatetraenoate | UniProt |
| Citations |
|---|